About 1,2-dimethoxybiphenylene;isocyanic acid
1,2-dimethoxybiphenylene;isocyanic acid (PubChem CID 87379313) has the molecular formula C16H14N2O4
and a molecular weight of 298.30 g/mol. Its IUPAC name is 1,2-dimethoxybiphenylene;isocyanic acid.
Molecular Properties
| Compound Name | 1,2-dimethoxybiphenylene;isocyanic acid |
| PubChem CID | 87379313 |
| Molecular Formula | C16H14N2O4 |
| Molecular Weight | 298.30 g/mol |
| Exact Mass | 298.10 |
| IUPAC Name | 1,2-dimethoxybiphenylene;isocyanic acid |
| SMILES | COc1ccc2c(c1OC)-c1ccccc1-2.N=C=O.N=C=O |
| InChI | InChI=1S/C14H12O2.2CHNO/c1-15-12-8-7-11-9-5-3-4-6-10(9)13(11)14(12)16-2;2*2-1-3/h3-8H,1-2H3;2*2H |
| InChIKey | IAESGUWDYRGJMP-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 100.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.30 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|
Analyze 1,2-dimethoxybiphenylene;isocyanic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2-dimethoxybiphenylene;isocyanic acid?
The IUPAC name of 1,2-dimethoxybiphenylene;isocyanic acid (CID 87379313) is 1,2-dimethoxybiphenylene;isocyanic acid.
What is the SMILES notation for 1,2-dimethoxybiphenylene;isocyanic acid?
The canonical SMILES for 1,2-dimethoxybiphenylene;isocyanic acid is COc1ccc2c(c1OC)-c1ccccc1-2.N=C=O.N=C=O.
What is the InChIKey of 1,2-dimethoxybiphenylene;isocyanic acid?
The InChIKey is IAESGUWDYRGJMP-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12O2.2CHNO/c1-15-12-8-7-11-9-5-3-4-6-10(9)13(11)14(12)16-2;2*2-1-3/h3-8H,1-2H3;2*2H.
What are the key properties of 1,2-dimethoxybiphenylene;isocyanic acid?
1,2-dimethoxybiphenylene;isocyanic acid has a molecular weight of 298.30 g/mol, XLogP of 3.15, 2 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2-dimethoxybiphenylene;isocyanic acid is sourced from PubChem (CID 87379313), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).