About 4-(difluoromethoxy)-N,N-dimethylbutan-1-amine
4-(difluoromethoxy)-N,N-dimethylbutan-1-amine (PubChem CID 87379412) has the molecular formula C7H15F2NO
and a molecular weight of 167.20 g/mol. Its IUPAC name is 4-(difluoromethoxy)-N,N-dimethylbutan-1-amine.
Molecular Properties
| Compound Name | 4-(difluoromethoxy)-N,N-dimethylbutan-1-amine |
| PubChem CID | 87379412 |
| Molecular Formula | C7H15F2NO |
| Molecular Weight | 167.20 g/mol |
| Exact Mass | 167.11 |
| IUPAC Name | 4-(difluoromethoxy)-N,N-dimethylbutan-1-amine |
| SMILES | CN(C)CCCCOC(F)F |
| InChI | InChI=1S/C7H15F2NO/c1-10(2)5-3-4-6-11-7(8)9/h7H,3-6H2,1-2H3 |
| InChIKey | AQGJISWDMVOCQI-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 167.20 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-(difluoromethoxy)-N,N-dimethylbutan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(difluoromethoxy)-N,N-dimethylbutan-1-amine?
The IUPAC name of 4-(difluoromethoxy)-N,N-dimethylbutan-1-amine (CID 87379412) is 4-(difluoromethoxy)-N,N-dimethylbutan-1-amine.
What is the SMILES notation for 4-(difluoromethoxy)-N,N-dimethylbutan-1-amine?
The canonical SMILES for 4-(difluoromethoxy)-N,N-dimethylbutan-1-amine is CN(C)CCCCOC(F)F.
What is the InChIKey of 4-(difluoromethoxy)-N,N-dimethylbutan-1-amine?
The InChIKey is AQGJISWDMVOCQI-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H15F2NO/c1-10(2)5-3-4-6-11-7(8)9/h7H,3-6H2,1-2H3.
What are the key properties of 4-(difluoromethoxy)-N,N-dimethylbutan-1-amine?
4-(difluoromethoxy)-N,N-dimethylbutan-1-amine has a molecular weight of 167.20 g/mol, XLogP of 1.57, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(difluoromethoxy)-N,N-dimethylbutan-1-amine is sourced from PubChem (CID 87379412), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).