C16H8BrF5N2O5S — CID 87379617
(3-bromo-4',4'-difluoro-5'-oxospiro[chromeno[2,3-b]pyridine-5,2'-pyrrolidine]-7-yl) trifluoromethanesulfonate (PubChem CID 87379617) has the molecular formula C16H8BrF5N2O5S and a molecular weight of 515.21 g/mol. Its IUPAC name is (3-bromo-4',4'-difluoro-5'-oxospiro[chromeno[2,3-b]pyridine-5,2'-pyrrolidine]-7-yl) trifluoromethanesulfonate.
| Compound Name | (3-bromo-4',4'-difluoro-5'-oxospiro[chromeno[2,3-b]pyridine-5,2'-pyrrolidine]-7-yl) trifluoromethanesulfonate |
|---|---|
| PubChem CID | 87379617 |
| Molecular Formula | C16H8BrF5N2O5S |
| Molecular Weight | 515.21 g/mol |
| Exact Mass | 513.93 |
| IUPAC Name | (3-bromo-4',4'-difluoro-5'-oxospiro[chromeno[2,3-b]pyridine-5,2'-pyrrolidine]-7-yl) trifluoromethanesulfonate |
| SMILES | O=C1NC2(CC1(F)F)c1cc(OS(=O)(=O)C(F)(F)F)ccc1Oc1ncc(Br)cc12 |
| InChI | InChI=1S/C16H8BrF5N2O5S/c17-7-3-10-12(23-5-7)28-11-2-1-8(29-30(26,27)16(20,21)22)4-9(11)14(10)6-15(18,19)13(25)24-14/h1-5H,6H2,(H,24,25) |
| InChIKey | FNJVEGVVESYREJ-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 94.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.21 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|