C23H27Cl3N2O3S — CID 87379703
S-[(4-chlorophenyl)methyl] N,N-diethylcarbamothioate;2,2-dichloro-1-(3-methyl-2,3-dihydro-1,4-benzoxazin-4-yl)ethanone (PubChem CID 87379703) has the molecular formula C23H27Cl3N2O3S and a molecular weight of 517.91 g/mol. Its IUPAC name is S-[(4-chlorophenyl)methyl] N,N-diethylcarbamothioate;2,2-dichloro-1-(3-methyl-2,3-dihydro-1,4-benzoxazin-4-yl)ethanone.
| Compound Name | S-[(4-chlorophenyl)methyl] N,N-diethylcarbamothioate;2,2-dichloro-1-(3-methyl-2,3-dihydro-1,4-benzoxazin-4-yl)ethanone |
|---|---|
| PubChem CID | 87379703 |
| Molecular Formula | C23H27Cl3N2O3S |
| Molecular Weight | 517.91 g/mol |
| Exact Mass | 516.08 |
| IUPAC Name | S-[(4-chlorophenyl)methyl] N,N-diethylcarbamothioate;2,2-dichloro-1-(3-methyl-2,3-dihydro-1,4-benzoxazin-4-yl)ethanone |
| SMILES | CC1COc2ccccc2N1C(=O)C(Cl)Cl.CCN(CC)C(=O)SCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C12H16ClNOS.C11H11Cl2NO2/c1-3-14(4-2)12(15)16-9-10-5-7-11(13)8-6-10;1-7-6-16-9-5-3-2-4-8(9)14(7)11(15)10(12)13/h5-8H,3-4,9H2,1-2H3;2-5,7,10H,6H2,1H3 |
| InChIKey | BPAURNVFVFRLIB-UHFFFAOYSA-N |
| XLogP | 6.64 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.91 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|