C21H27Cl5N2O3S — CID 87379965
2,2-dichloro-1-(3-methyl-2,3-dihydro-1,4-benzoxazin-4-yl)ethanone;S-(2,3,3-trichloroprop-2-enyl) N,N-di(propan-2-yl)carbamothioate (PubChem CID 87379965) has the molecular formula C21H27Cl5N2O3S and a molecular weight of 564.79 g/mol. Its IUPAC name is 2,2-dichloro-1-(3-methyl-2,3-dihydro-1,4-benzoxazin-4-yl)ethanone;S-(2,3,3-trichloroprop-2-enyl) N,N-di(propan-2-yl)carbamothioate.
| Compound Name | 2,2-dichloro-1-(3-methyl-2,3-dihydro-1,4-benzoxazin-4-yl)ethanone;S-(2,3,3-trichloroprop-2-enyl) N,N-di(propan-2-yl)carbamothioate |
|---|---|
| PubChem CID | 87379965 |
| Molecular Formula | C21H27Cl5N2O3S |
| Molecular Weight | 564.79 g/mol |
| Exact Mass | 562.02 |
| IUPAC Name | 2,2-dichloro-1-(3-methyl-2,3-dihydro-1,4-benzoxazin-4-yl)ethanone;S-(2,3,3-trichloroprop-2-enyl) N,N-di(propan-2-yl)carbamothioate |
| SMILES | CC(C)N(C(=O)SCC(Cl)=C(Cl)Cl)C(C)C.CC1COc2ccccc2N1C(=O)C(Cl)Cl |
| InChI | InChI=1S/C11H11Cl2NO2.C10H16Cl3NOS/c1-7-6-16-9-5-3-2-4-8(9)14(7)11(15)10(12)13;1-6(2)14(7(3)4)10(15)16-5-8(11)9(12)13/h2-5,7,10H,6H2,1H3;6-7H,5H2,1-4H3 |
| InChIKey | LMMVYFMMQFKVEO-UHFFFAOYSA-N |
| XLogP | 7.45 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.79 |
| LogP ≤ 5 | 7.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|