C25H31Cl2N7O8S — CID 87380059
2,2-dichloro-N,N-bis(prop-2-enyl)acetamide;2-[(4,6-dimethoxypyrimidin-2-yl)carbamoylsulfamoyl]-4-formamido-N,N-dimethylbenzamide (PubChem CID 87380059) has the molecular formula C25H31Cl2N7O8S and a molecular weight of 660.54 g/mol. Its IUPAC name is 2,2-dichloro-N,N-bis(prop-2-enyl)acetamide;2-[(4,6-dimethoxypyrimidin-2-yl)carbamoylsulfamoyl]-4-formamido-N,N-dimethylbenzamide.
| Compound Name | 2,2-dichloro-N,N-bis(prop-2-enyl)acetamide;2-[(4,6-dimethoxypyrimidin-2-yl)carbamoylsulfamoyl]-4-formamido-N,N-dimethylbenzamide |
|---|---|
| PubChem CID | 87380059 |
| Molecular Formula | C25H31Cl2N7O8S |
| Molecular Weight | 660.54 g/mol |
| Exact Mass | 659.13 |
| IUPAC Name | 2,2-dichloro-N,N-bis(prop-2-enyl)acetamide;2-[(4,6-dimethoxypyrimidin-2-yl)carbamoylsulfamoyl]-4-formamido-N,N-dimethylbenzamide |
| SMILES | C=CCN(CC=C)C(=O)C(Cl)Cl.COc1cc(OC)nc(NC(=O)NS(=O)(=O)c2cc(NC=O)ccc2C(=O)N(C)C)n1 |
| InChI | InChI=1S/C17H20N6O7S.C8H11Cl2NO/c1-23(2)15(25)11-6-5-10(18-9-24)7-12(11)31(27,28)22-17(26)21-16-19-13(29-3)8-14(20-16)30-4;1-3-5-11(6-4-2)8(12)7(9)10/h5-9H,1-4H3,(H,18,24)(H2,19,20,21,22,26);3-4,7H,1-2,5-6H2 |
| InChIKey | HHKHXUWRZXVFMQ-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 189.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.54 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|