About methyl 3-hydroxy-4,4-dimethoxy-2-methylidenebutanoate
methyl 3-hydroxy-4,4-dimethoxy-2-methylidenebutanoate (PubChem CID 87380140) has the molecular formula C8H14O5
and a molecular weight of 190.19 g/mol. Its IUPAC name is methyl 3-hydroxy-4,4-dimethoxy-2-methylidenebutanoate.
Molecular Properties
| Compound Name | methyl 3-hydroxy-4,4-dimethoxy-2-methylidenebutanoate |
| PubChem CID | 87380140 |
| Molecular Formula | C8H14O5 |
| Molecular Weight | 190.19 g/mol |
| Exact Mass | 190.08 |
| IUPAC Name | methyl 3-hydroxy-4,4-dimethoxy-2-methylidenebutanoate |
| SMILES | C=C(C(=O)OC)C(O)C(OC)OC |
| InChI | InChI=1S/C8H14O5/c1-5(7(10)11-2)6(9)8(12-3)13-4/h6,8-9H,1H2,2-4H3 |
| InChIKey | GKQUDRVBKOCIHK-UHFFFAOYSA-N |
| XLogP | -0.30 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.19 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze methyl 3-hydroxy-4,4-dimethoxy-2-methylidenebutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-hydroxy-4,4-dimethoxy-2-methylidenebutanoate?
The IUPAC name of methyl 3-hydroxy-4,4-dimethoxy-2-methylidenebutanoate (CID 87380140) is methyl 3-hydroxy-4,4-dimethoxy-2-methylidenebutanoate.
What is the SMILES notation for methyl 3-hydroxy-4,4-dimethoxy-2-methylidenebutanoate?
The canonical SMILES for methyl 3-hydroxy-4,4-dimethoxy-2-methylidenebutanoate is C=C(C(=O)OC)C(O)C(OC)OC.
What is the InChIKey of methyl 3-hydroxy-4,4-dimethoxy-2-methylidenebutanoate?
The InChIKey is GKQUDRVBKOCIHK-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14O5/c1-5(7(10)11-2)6(9)8(12-3)13-4/h6,8-9H,1H2,2-4H3.
What are the key properties of methyl 3-hydroxy-4,4-dimethoxy-2-methylidenebutanoate?
methyl 3-hydroxy-4,4-dimethoxy-2-methylidenebutanoate has a molecular weight of 190.19 g/mol, XLogP of -0.30, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-hydroxy-4,4-dimethoxy-2-methylidenebutanoate is sourced from PubChem (CID 87380140), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).