About 2-(dioxan-4-yl)-N,N-dimethylacetamide
2-(dioxan-4-yl)-N,N-dimethylacetamide (PubChem CID 87380199) has the molecular formula C8H15NO3
and a molecular weight of 173.21 g/mol. Its IUPAC name is 2-(dioxan-4-yl)-N,N-dimethylacetamide.
Molecular Properties
| Compound Name | 2-(dioxan-4-yl)-N,N-dimethylacetamide |
| PubChem CID | 87380199 |
| Molecular Formula | C8H15NO3 |
| Molecular Weight | 173.21 g/mol |
| Exact Mass | 173.11 |
| IUPAC Name | 2-(dioxan-4-yl)-N,N-dimethylacetamide |
| SMILES | CN(C)C(=O)CC1CCOOC1 |
| InChI | InChI=1S/C8H15NO3/c1-9(2)8(10)5-7-3-4-11-12-6-7/h7H,3-6H2,1-2H3 |
| InChIKey | FRJODUSHJWJCPN-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 173.21 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze 2-(dioxan-4-yl)-N,N-dimethylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(dioxan-4-yl)-N,N-dimethylacetamide?
The IUPAC name of 2-(dioxan-4-yl)-N,N-dimethylacetamide (CID 87380199) is 2-(dioxan-4-yl)-N,N-dimethylacetamide.
What is the SMILES notation for 2-(dioxan-4-yl)-N,N-dimethylacetamide?
The canonical SMILES for 2-(dioxan-4-yl)-N,N-dimethylacetamide is CN(C)C(=O)CC1CCOOC1.
What is the InChIKey of 2-(dioxan-4-yl)-N,N-dimethylacetamide?
The InChIKey is FRJODUSHJWJCPN-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15NO3/c1-9(2)8(10)5-7-3-4-11-12-6-7/h7H,3-6H2,1-2H3.
What are the key properties of 2-(dioxan-4-yl)-N,N-dimethylacetamide?
2-(dioxan-4-yl)-N,N-dimethylacetamide has a molecular weight of 173.21 g/mol, XLogP of 0.43, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(dioxan-4-yl)-N,N-dimethylacetamide is sourced from PubChem (CID 87380199), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).