About 1,8-dihydroindeno[2,1-c]pyrazole
1,8-dihydroindeno[2,1-c]pyrazole (PubChem CID 87380296) has the molecular formula C10H8N2
and a molecular weight of 156.19 g/mol. Its IUPAC name is 1,8-dihydroindeno[2,1-c]pyrazole.
Molecular Properties
| Compound Name | 1,8-dihydroindeno[2,1-c]pyrazole |
| PubChem CID | 87380296 |
| Molecular Formula | C10H8N2 |
| Molecular Weight | 156.19 g/mol |
| Exact Mass | 156.07 |
| IUPAC Name | 1,8-dihydroindeno[2,1-c]pyrazole |
| SMILES | C1=CCC2=C3CN=NC3=CC2=C1 |
| InChI | InChI=1S/C10H8N2/c1-2-4-8-7(3-1)5-10-9(8)6-11-12-10/h1-3,5H,4,6H2 |
| InChIKey | SDYZKNSKIFQTHH-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.19 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1,8-dihydroindeno[2,1-c]pyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,8-dihydroindeno[2,1-c]pyrazole?
The IUPAC name of 1,8-dihydroindeno[2,1-c]pyrazole (CID 87380296) is 1,8-dihydroindeno[2,1-c]pyrazole.
What is the SMILES notation for 1,8-dihydroindeno[2,1-c]pyrazole?
The canonical SMILES for 1,8-dihydroindeno[2,1-c]pyrazole is C1=CCC2=C3CN=NC3=CC2=C1.
What is the InChIKey of 1,8-dihydroindeno[2,1-c]pyrazole?
The InChIKey is SDYZKNSKIFQTHH-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8N2/c1-2-4-8-7(3-1)5-10-9(8)6-11-12-10/h1-3,5H,4,6H2.
What are the key properties of 1,8-dihydroindeno[2,1-c]pyrazole?
1,8-dihydroindeno[2,1-c]pyrazole has a molecular weight of 156.19 g/mol, XLogP of 2.53, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,8-dihydroindeno[2,1-c]pyrazole is sourced from PubChem (CID 87380296), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).