C22H24N8O3S — CID 87380318
4-(2-aminopyrimidin-5-yl)-2-morpholin-4-yl-5,6-dihydropyrrolo[2,3-d]pyrimidine-7-carbothioic S-acid;benzamide (PubChem CID 87380318) has the molecular formula C22H24N8O3S and a molecular weight of 480.55 g/mol. Its IUPAC name is 4-(2-aminopyrimidin-5-yl)-2-morpholin-4-yl-5,6-dihydropyrrolo[2,3-d]pyrimidine-7-carbothioic S-acid;benzamide.
| Compound Name | 4-(2-aminopyrimidin-5-yl)-2-morpholin-4-yl-5,6-dihydropyrrolo[2,3-d]pyrimidine-7-carbothioic S-acid;benzamide |
|---|---|
| PubChem CID | 87380318 |
| Molecular Formula | C22H24N8O3S |
| Molecular Weight | 480.55 g/mol |
| Exact Mass | 480.17 |
| IUPAC Name | 4-(2-aminopyrimidin-5-yl)-2-morpholin-4-yl-5,6-dihydropyrrolo[2,3-d]pyrimidine-7-carbothioic S-acid;benzamide |
| SMILES | NC(=O)c1ccccc1.Nc1ncc(-c2nc(N3CCOCC3)nc3c2CCN3C(=O)S)cn1 |
| InChI | InChI=1S/C15H17N7O2S.C7H7NO/c16-13-17-7-9(8-18-13)11-10-1-2-22(15(23)25)12(10)20-14(19-11)21-3-5-24-6-4-21;8-7(9)6-4-2-1-3-5-6/h7-8H,1-6H2,(H,23,25)(H2,16,17,18);1-5H,(H2,8,9) |
| InChIKey | QYORGLJRYMLVHV-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 153.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.55 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|