C10H14F5NO2S — CID 87380447
(2R)-3-(cyclopropylmethylsulfanyl)-2-(2,2,3,3,3-pentafluoropropylamino)propanoic acid (PubChem CID 87380447) has the molecular formula C10H14F5NO2S and a molecular weight of 307.28 g/mol. Its IUPAC name is (2R)-3-(cyclopropylmethylsulfanyl)-2-(2,2,3,3,3-pentafluoropropylamino)propanoic acid.
| Compound Name | (2R)-3-(cyclopropylmethylsulfanyl)-2-(2,2,3,3,3-pentafluoropropylamino)propanoic acid |
|---|---|
| PubChem CID | 87380447 |
| Molecular Formula | C10H14F5NO2S |
| Molecular Weight | 307.28 g/mol |
| Exact Mass | 307.07 |
| IUPAC Name | (2R)-3-(cyclopropylmethylsulfanyl)-2-(2,2,3,3,3-pentafluoropropylamino)propanoic acid |
| SMILES | O=C(O)[C@H](CSCC1CC1)NCC(F)(F)C(F)(F)F |
| InChI | InChI=1S/C10H14F5NO2S/c11-9(12,10(13,14)15)5-16-7(8(17)18)4-19-3-6-1-2-6/h6-7,16H,1-5H2,(H,17,18)/t7-/m0/s1 |
| InChIKey | AKJJVSWSOMCLNT-ZETCQYMHSA-N |
| XLogP | 2.37 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.28 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|