About azanium;4-tert-butylbenzene-1,2-diol;oxido(dioxo)vanadium
azanium;4-tert-butylbenzene-1,2-diol;oxido(dioxo)vanadium (PubChem CID 87380509) has the molecular formula C10H18NO5V
and a molecular weight of 283.20 g/mol. Its IUPAC name is azanium;4-tert-butylbenzene-1,2-diol;oxido(dioxo)vanadium.
Molecular Properties
| Compound Name | azanium;4-tert-butylbenzene-1,2-diol;oxido(dioxo)vanadium |
| PubChem CID | 87380509 |
| Molecular Formula | C10H18NO5V |
| Molecular Weight | 283.20 g/mol |
| Exact Mass | 283.06 |
| IUPAC Name | azanium;4-tert-butylbenzene-1,2-diol;oxido(dioxo)vanadium |
| SMILES | CC(C)(C)c1ccc(O)c(O)c1.O=[V](=O)[O-].[NH4+] |
| InChI | InChI=1S/C10H14O2.H3N.3O.V/c1-10(2,3)7-4-5-8(11)9(12)6-7;;;;;/h4-6,11-12H,1-3H3;1H3;;;;/q;;;;-1;/p+1 |
| InChIKey | BMNOJGJNQPVFBI-UHFFFAOYSA-O |
| XLogP | 1.34 |
| TPSA | 134.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.20 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|
Analyze azanium;4-tert-butylbenzene-1,2-diol;oxido(dioxo)vanadium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azanium;4-tert-butylbenzene-1,2-diol;oxido(dioxo)vanadium?
The IUPAC name of azanium;4-tert-butylbenzene-1,2-diol;oxido(dioxo)vanadium (CID 87380509) is azanium;4-tert-butylbenzene-1,2-diol;oxido(dioxo)vanadium.
What is the SMILES notation for azanium;4-tert-butylbenzene-1,2-diol;oxido(dioxo)vanadium?
The canonical SMILES for azanium;4-tert-butylbenzene-1,2-diol;oxido(dioxo)vanadium is CC(C)(C)c1ccc(O)c(O)c1.O=[V](=O)[O-].[NH4+].
What is the InChIKey of azanium;4-tert-butylbenzene-1,2-diol;oxido(dioxo)vanadium?
The InChIKey is BMNOJGJNQPVFBI-UHFFFAOYSA-O. The full InChI is InChI=1S/C10H14O2.H3N.3O.V/c1-10(2,3)7-4-5-8(11)9(12)6-7;;;;;/h4-6,11-12H,1-3H3;1H3;;;;/q;;;;-1;/p+1.
What are the key properties of azanium;4-tert-butylbenzene-1,2-diol;oxido(dioxo)vanadium?
azanium;4-tert-butylbenzene-1,2-diol;oxido(dioxo)vanadium has a molecular weight of 283.20 g/mol, XLogP of 1.34, 0 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for azanium;4-tert-butylbenzene-1,2-diol;oxido(dioxo)vanadium is sourced from PubChem (CID 87380509), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).