About cyclopenta-1,3-diene;penta-1,3-dienoxybenzene;propan-2-ylidenetitanium(1+)
cyclopenta-1,3-diene;penta-1,3-dienoxybenzene;propan-2-ylidenetitanium(1+) (PubChem CID 87380685) has the molecular formula C19H23OTi
and a molecular weight of 315.26 g/mol. Its IUPAC name is cyclopenta-1,3-diene;penta-1,3-dienoxybenzene;propan-2-ylidenetitanium(1+).
Molecular Properties
| Compound Name | cyclopenta-1,3-diene;penta-1,3-dienoxybenzene;propan-2-ylidenetitanium(1+) |
| PubChem CID | 87380685 |
| Molecular Formula | C19H23OTi |
| Molecular Weight | 315.26 g/mol |
| Exact Mass | 315.12 |
| IUPAC Name | cyclopenta-1,3-diene;penta-1,3-dienoxybenzene;propan-2-ylidenetitanium(1+) |
| SMILES | CC(C)=[Ti+].CC=CC=COc1ccccc1.[C-]1=CC=CC1 |
| InChI | InChI=1S/C11H12O.C5H5.C3H6.Ti/c1-2-3-7-10-12-11-8-5-4-6-9-11;1-2-4-5-3-1;1-3-2;/h2-10H,1H3;1-3H,4H2;1-2H3;/q;-1;;+1 |
| InChIKey | XTUFFRCHOIVDJF-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 315.26 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze cyclopenta-1,3-diene;penta-1,3-dienoxybenzene;propan-2-ylidenetitanium(1+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclopenta-1,3-diene;penta-1,3-dienoxybenzene;propan-2-ylidenetitanium(1+)?
The IUPAC name of cyclopenta-1,3-diene;penta-1,3-dienoxybenzene;propan-2-ylidenetitanium(1+) (CID 87380685) is cyclopenta-1,3-diene;penta-1,3-dienoxybenzene;propan-2-ylidenetitanium(1+).
What is the SMILES notation for cyclopenta-1,3-diene;penta-1,3-dienoxybenzene;propan-2-ylidenetitanium(1+)?
The canonical SMILES for cyclopenta-1,3-diene;penta-1,3-dienoxybenzene;propan-2-ylidenetitanium(1+) is CC(C)=[Ti+].CC=CC=COc1ccccc1.[C-]1=CC=CC1.
What is the InChIKey of cyclopenta-1,3-diene;penta-1,3-dienoxybenzene;propan-2-ylidenetitanium(1+)?
The InChIKey is XTUFFRCHOIVDJF-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12O.C5H5.C3H6.Ti/c1-2-3-7-10-12-11-8-5-4-6-9-11;1-2-4-5-3-1;1-3-2;/h2-10H,1H3;1-3H,4H2;1-2H3;/q;-1;;+1.
What are the key properties of cyclopenta-1,3-diene;penta-1,3-dienoxybenzene;propan-2-ylidenetitanium(1+)?
cyclopenta-1,3-diene;penta-1,3-dienoxybenzene;propan-2-ylidenetitanium(1+) has a molecular weight of 315.26 g/mol, XLogP of 5.21, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for cyclopenta-1,3-diene;penta-1,3-dienoxybenzene;propan-2-ylidenetitanium(1+) is sourced from PubChem (CID 87380685), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).