C23H15BrO2 — CID 87380736
18-bromo-21,21-dimethylpentacyclo[11.8.0.03,11.04,9.015,20]henicosa-1,3,6,8,10,13,15(20),16,18-nonaene-5,12-dione (PubChem CID 87380736) has the molecular formula C23H15BrO2 and a molecular weight of 403.28 g/mol. Its IUPAC name is 18-bromo-21,21-dimethylpentacyclo[11.8.0.03,11.04,9.015,20]henicosa-1,3,6,8,10,13,15(20),16,18-nonaene-5,12-dione.
| Compound Name | 18-bromo-21,21-dimethylpentacyclo[11.8.0.03,11.04,9.015,20]henicosa-1,3,6,8,10,13,15(20),16,18-nonaene-5,12-dione |
|---|---|
| PubChem CID | 87380736 |
| Molecular Formula | C23H15BrO2 |
| Molecular Weight | 403.28 g/mol |
| Exact Mass | 402.03 |
| IUPAC Name | 18-bromo-21,21-dimethylpentacyclo[11.8.0.03,11.04,9.015,20]henicosa-1,3,6,8,10,13,15(20),16,18-nonaene-5,12-dione |
| SMILES | CC1(C)C2=CC3=C4C(=O)C=CC=C4C=C3C(=O)C2=Cc2ccc(Br)cc21 |
| InChI | InChI=1S/C23H15BrO2/c1-23(2)18-10-14(24)7-6-12(18)8-17-19(23)11-15-16(22(17)26)9-13-4-3-5-20(25)21(13)15/h3-11H,1-2H3 |
| InChIKey | IQJDUDRLRNGSNK-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.28 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |