C24H19ClN8O2 — CID 87381292
4-N-[(6-chloro-3-pyridinyl)methyl]-1-methyl-5-N-(2-phenylimidazo[1,2-a]pyrimidin-7-yl)pyrazole-4,5-dicarboxamide (PubChem CID 87381292) has the molecular formula C24H19ClN8O2 and a molecular weight of 486.92 g/mol. Its IUPAC name is 4-N-[(6-chloro-3-pyridinyl)methyl]-1-methyl-5-N-(2-phenylimidazo[1,2-a]pyrimidin-7-yl)pyrazole-4,5-dicarboxamide.
| Compound Name | 4-N-[(6-chloro-3-pyridinyl)methyl]-1-methyl-5-N-(2-phenylimidazo[1,2-a]pyrimidin-7-yl)pyrazole-4,5-dicarboxamide |
|---|---|
| PubChem CID | 87381292 |
| Molecular Formula | C24H19ClN8O2 |
| Molecular Weight | 486.92 g/mol |
| Exact Mass | 486.13 |
| IUPAC Name | 4-N-[(6-chloro-3-pyridinyl)methyl]-1-methyl-5-N-(2-phenylimidazo[1,2-a]pyrimidin-7-yl)pyrazole-4,5-dicarboxamide |
| SMILES | Cn1ncc(C(=O)NCc2ccc(Cl)nc2)c1C(=O)Nc1ccn2cc(-c3ccccc3)nc2n1 |
| InChI | InChI=1S/C24H19ClN8O2/c1-32-21(17(13-28-32)22(34)27-12-15-7-8-19(25)26-11-15)23(35)30-20-9-10-33-14-18(29-24(33)31-20)16-5-3-2-4-6-16/h2-11,13-14H,12H2,1H3,(H,27,34)(H,29,30,31,35) |
| InChIKey | CXBKVMHAIPYMON-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 119.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.92 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|