C23H20ClNO4 — CID 8738170
[(2R)-1-(2-chloroanilino)-1-oxopropan-2-yl] 4-(phenoxymethyl)benzoate (PubChem CID 8738170) has the molecular formula C23H20ClNO4 and a molecular weight of 409.87 g/mol. Its IUPAC name is [(2R)-1-(2-chloroanilino)-1-oxopropan-2-yl] 4-(phenoxymethyl)benzoate.
| Compound Name | [(2R)-1-(2-chloroanilino)-1-oxopropan-2-yl] 4-(phenoxymethyl)benzoate |
|---|---|
| PubChem CID | 8738170 |
| Molecular Formula | C23H20ClNO4 |
| Molecular Weight | 409.87 g/mol |
| Exact Mass | 409.11 |
| IUPAC Name | [(2R)-1-(2-chloroanilino)-1-oxopropan-2-yl] 4-(phenoxymethyl)benzoate |
| SMILES | C[C@@H](OC(=O)c1ccc(COc2ccccc2)cc1)C(=O)Nc1ccccc1Cl |
| InChI | InChI=1S/C23H20ClNO4/c1-16(22(26)25-21-10-6-5-9-20(21)24)29-23(27)18-13-11-17(12-14-18)15-28-19-7-3-2-4-8-19/h2-14,16H,15H2,1H3,(H,25,26)/t16-/m1/s1 |
| InChIKey | XLGSTBQTUQQVKD-MRXNPFEDSA-N |
| XLogP | 5.10 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.87 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |