C25H32Si — CID 87381858
trimethyl-[4-[2-[(1-propylcyclopropyl)methyl]-1H-inden-4-yl]phenyl]silane (PubChem CID 87381858) has the molecular formula C25H32Si and a molecular weight of 360.62 g/mol. Its IUPAC name is trimethyl-[4-[2-[(1-propylcyclopropyl)methyl]-1H-inden-4-yl]phenyl]silane.
| Compound Name | trimethyl-[4-[2-[(1-propylcyclopropyl)methyl]-1H-inden-4-yl]phenyl]silane |
|---|---|
| PubChem CID | 87381858 |
| Molecular Formula | C25H32Si |
| Molecular Weight | 360.62 g/mol |
| Exact Mass | 360.23 |
| IUPAC Name | trimethyl-[4-[2-[(1-propylcyclopropyl)methyl]-1H-inden-4-yl]phenyl]silane |
| SMILES | CCCC1(CC2=Cc3c(cccc3-c3ccc([Si](C)(C)C)cc3)C2)CC1 |
| InChI | InChI=1S/C25H32Si/c1-5-13-25(14-15-25)18-19-16-21-7-6-8-23(24(21)17-19)20-9-11-22(12-10-20)26(2,3)4/h6-12,17H,5,13-16,18H2,1-4H3 |
| InChIKey | UNLAQMPBCKAWAQ-UHFFFAOYSA-N |
| XLogP | 6.81 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.62 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|