About 2-(butylamino)ethyl 2-methylprop-2-enoate;2-methylidenedecanamide;prop-2-enoic acid
2-(butylamino)ethyl 2-methylprop-2-enoate;2-methylidenedecanamide;prop-2-enoic acid (PubChem CID 87381903) has the molecular formula C24H44N2O5
and a molecular weight of 440.63 g/mol. Its IUPAC name is 2-(butylamino)ethyl 2-methylprop-2-enoate;2-methylidenedecanamide;prop-2-enoic acid.
Molecular Properties
| Compound Name | 2-(butylamino)ethyl 2-methylprop-2-enoate;2-methylidenedecanamide;prop-2-enoic acid |
| PubChem CID | 87381903 |
| Molecular Formula | C24H44N2O5 |
| Molecular Weight | 440.63 g/mol |
| Exact Mass | 440.33 |
| IUPAC Name | 2-(butylamino)ethyl 2-methylprop-2-enoate;2-methylidenedecanamide;prop-2-enoic acid |
| SMILES | C=C(C)C(=O)OCCNCCCC.C=C(CCCCCCCC)C(N)=O.C=CC(=O)O |
| InChI | InChI=1S/C11H21NO.C10H19NO2.C3H4O2/c1-3-4-5-6-7-8-9-10(2)11(12)13;1-4-5-6-11-7-8-13-10(12)9(2)3;1-2-3(4)5/h2-9H2,1H3,(H2,12,13);11H,2,4-8H2,1,3H3;2H,1H2,(H,4,5) |
| InChIKey | AUPQLTZZQNSZKT-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 118.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 440.63 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2-(butylamino)ethyl 2-methylprop-2-enoate;2-methylidenedecanamide;prop-2-enoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(butylamino)ethyl 2-methylprop-2-enoate;2-methylidenedecanamide;prop-2-enoic acid?
The IUPAC name of 2-(butylamino)ethyl 2-methylprop-2-enoate;2-methylidenedecanamide;prop-2-enoic acid (CID 87381903) is 2-(butylamino)ethyl 2-methylprop-2-enoate;2-methylidenedecanamide;prop-2-enoic acid.
What is the SMILES notation for 2-(butylamino)ethyl 2-methylprop-2-enoate;2-methylidenedecanamide;prop-2-enoic acid?
The canonical SMILES for 2-(butylamino)ethyl 2-methylprop-2-enoate;2-methylidenedecanamide;prop-2-enoic acid is C=C(C)C(=O)OCCNCCCC.C=C(CCCCCCCC)C(N)=O.C=CC(=O)O.
What is the InChIKey of 2-(butylamino)ethyl 2-methylprop-2-enoate;2-methylidenedecanamide;prop-2-enoic acid?
The InChIKey is AUPQLTZZQNSZKT-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H21NO.C10H19NO2.C3H4O2/c1-3-4-5-6-7-8-9-10(2)11(12)13;1-4-5-6-11-7-8-13-10(12)9(2)3;1-2-3(4)5/h2-9H2,1H3,(H2,12,13);11H,2,4-8H2,1,3H3;2H,1H2,(H,4,5).
What are the key properties of 2-(butylamino)ethyl 2-methylprop-2-enoate;2-methylidenedecanamide;prop-2-enoic acid?
2-(butylamino)ethyl 2-methylprop-2-enoate;2-methylidenedecanamide;prop-2-enoic acid has a molecular weight of 440.63 g/mol, XLogP of 4.53, 16 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(butylamino)ethyl 2-methylprop-2-enoate;2-methylidenedecanamide;prop-2-enoic acid is sourced from PubChem (CID 87381903), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).