C8H4F6N4O3 — CID 87382266
2-isocyanato-4,6-bis(2,2,2-trifluoroethoxy)-1,3,5-triazine (PubChem CID 87382266) has the molecular formula C8H4F6N4O3 and a molecular weight of 318.13 g/mol. Its IUPAC name is 2-isocyanato-4,6-bis(2,2,2-trifluoroethoxy)-1,3,5-triazine.
| Compound Name | 2-isocyanato-4,6-bis(2,2,2-trifluoroethoxy)-1,3,5-triazine |
|---|---|
| PubChem CID | 87382266 |
| Molecular Formula | C8H4F6N4O3 |
| Molecular Weight | 318.13 g/mol |
| Exact Mass | 318.02 |
| IUPAC Name | 2-isocyanato-4,6-bis(2,2,2-trifluoroethoxy)-1,3,5-triazine |
| SMILES | O=C=Nc1nc(OCC(F)(F)F)nc(OCC(F)(F)F)n1 |
| InChI | InChI=1S/C8H4F6N4O3/c9-7(10,11)1-20-5-16-4(15-3-19)17-6(18-5)21-2-8(12,13)14/h1-2H2 |
| InChIKey | LBPKRPSJKBHQKB-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 86.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.13 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|