About (2S)-2-[acetyl(ethyl)amino]-2,3,3-trifluoropropanoic acid
(2S)-2-[acetyl(ethyl)amino]-2,3,3-trifluoropropanoic acid (PubChem CID 87382971) has the molecular formula C7H10F3NO3
and a molecular weight of 213.15 g/mol. Its IUPAC name is (2S)-2-[acetyl(ethyl)amino]-2,3,3-trifluoropropanoic acid.
Molecular Properties
| Compound Name | (2S)-2-[acetyl(ethyl)amino]-2,3,3-trifluoropropanoic acid |
| PubChem CID | 87382971 |
| Molecular Formula | C7H10F3NO3 |
| Molecular Weight | 213.15 g/mol |
| Exact Mass | 213.06 |
| IUPAC Name | (2S)-2-[acetyl(ethyl)amino]-2,3,3-trifluoropropanoic acid |
| SMILES | CCN(C(=O)C)[C@@](C(F)F)(C(=O)O)F |
| InChI | InChI=1S/C7H10F3NO3/c1-3-11(4(2)12)7(10,5(8)9)6(13)14/h5H,3H2,1-2H3,(H,13,14)/t7-/m0/s1 |
| InChIKey | JYPGSJUVTYUKDS-ZETCQYMHSA-N |
| XLogP | 0.80 |
| TPSA | 57.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | 246 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.15 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze (2S)-2-[acetyl(ethyl)amino]-2,3,3-trifluoropropanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-[acetyl(ethyl)amino]-2,3,3-trifluoropropanoic acid?
The IUPAC name of (2S)-2-[acetyl(ethyl)amino]-2,3,3-trifluoropropanoic acid (CID 87382971) is (2S)-2-[acetyl(ethyl)amino]-2,3,3-trifluoropropanoic acid.
What is the SMILES notation for (2S)-2-[acetyl(ethyl)amino]-2,3,3-trifluoropropanoic acid?
The canonical SMILES for (2S)-2-[acetyl(ethyl)amino]-2,3,3-trifluoropropanoic acid is CCN(C(=O)C)[C@@](C(F)F)(C(=O)O)F.
What is the InChIKey of (2S)-2-[acetyl(ethyl)amino]-2,3,3-trifluoropropanoic acid?
The InChIKey is JYPGSJUVTYUKDS-ZETCQYMHSA-N. The full InChI is InChI=1S/C7H10F3NO3/c1-3-11(4(2)12)7(10,5(8)9)6(13)14/h5H,3H2,1-2H3,(H,13,14)/t7-/m0/s1.
What are the key properties of (2S)-2-[acetyl(ethyl)amino]-2,3,3-trifluoropropanoic acid?
(2S)-2-[acetyl(ethyl)amino]-2,3,3-trifluoropropanoic acid has a molecular weight of 213.15 g/mol, XLogP of 0.80, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-[acetyl(ethyl)amino]-2,3,3-trifluoropropanoic acid is sourced from PubChem (CID 87382971), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).