2-sulfanyl-2-(1,3-thiazol-2-yl)acetic acid

C5H5NO2S2 — CID 87383007

IUPAC2-sulfanyl-2-(1,3-thiazol-2-yl)acetic acid
SMILESO=C(O)C(S)c1nccs1
InChIInChI=1S/C5H5NO2S2/c7-5(8)3(9)4-6-1-2-10-4/h1-3,9H,(H,7,8)
InChIKeyMOGPGJDHIWIBJV-UHFFFAOYSA-N
MW175.23 g/mol
LogP1.20
Rot. Bonds2

About 2-sulfanyl-2-(1,3-thiazol-2-yl)acetic acid

2-sulfanyl-2-(1,3-thiazol-2-yl)acetic acid (PubChem CID 87383007) has the molecular formula C5H5NO2S2 and a molecular weight of 175.23 g/mol. Its IUPAC name is 2-sulfanyl-2-(1,3-thiazol-2-yl)acetic acid.

Molecular Properties

Compound Name2-sulfanyl-2-(1,3-thiazol-2-yl)acetic acid
PubChem CID87383007
Molecular FormulaC5H5NO2S2
Molecular Weight175.23 g/mol
Exact Mass174.98
IUPAC Name2-sulfanyl-2-(1,3-thiazol-2-yl)acetic acid
SMILESO=C(O)C(S)c1nccs1
InChIInChI=1S/C5H5NO2S2/c7-5(8)3(9)4-6-1-2-10-4/h1-3,9H,(H,7,8)
InChIKeyMOGPGJDHIWIBJV-UHFFFAOYSA-N
XLogP1.20
TPSA50.19 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds2
Heavy Atoms10
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500175.23
LogP ≤ 51.20
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'thiol_2', 'substructure': 'N/A'}

Analyze 2-sulfanyl-2-(1,3-thiazol-2-yl)acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-sulfanyl-2-(1,3-thiazol-2-yl)acetic acid?
The IUPAC name of 2-sulfanyl-2-(1,3-thiazol-2-yl)acetic acid (CID 87383007) is 2-sulfanyl-2-(1,3-thiazol-2-yl)acetic acid.
What is the SMILES notation for 2-sulfanyl-2-(1,3-thiazol-2-yl)acetic acid?
The canonical SMILES for 2-sulfanyl-2-(1,3-thiazol-2-yl)acetic acid is O=C(O)C(S)c1nccs1.
What is the InChIKey of 2-sulfanyl-2-(1,3-thiazol-2-yl)acetic acid?
The InChIKey is MOGPGJDHIWIBJV-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H5NO2S2/c7-5(8)3(9)4-6-1-2-10-4/h1-3,9H,(H,7,8).
What are the key properties of 2-sulfanyl-2-(1,3-thiazol-2-yl)acetic acid?
2-sulfanyl-2-(1,3-thiazol-2-yl)acetic acid has a molecular weight of 175.23 g/mol, XLogP of 1.20, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-sulfanyl-2-(1,3-thiazol-2-yl)acetic acid is sourced from PubChem (CID 87383007), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).