C18H30O3 — CID 87383170
1,1-dimethoxyethane;2-methyl-3-[4-(2-methylpropyl)phenyl]propanal (PubChem CID 87383170) has the molecular formula C18H30O3 and a molecular weight of 294.44 g/mol. Its IUPAC name is 1,1-dimethoxyethane;2-methyl-3-[4-(2-methylpropyl)phenyl]propanal.
| Compound Name | 1,1-dimethoxyethane;2-methyl-3-[4-(2-methylpropyl)phenyl]propanal |
|---|---|
| PubChem CID | 87383170 |
| Molecular Formula | C18H30O3 |
| Molecular Weight | 294.44 g/mol |
| Exact Mass | 294.22 |
| IUPAC Name | 1,1-dimethoxyethane;2-methyl-3-[4-(2-methylpropyl)phenyl]propanal |
| SMILES | CC(C)Cc1ccc(CC(C)C=O)cc1.COC(C)OC |
| InChI | InChI=1S/C14H20O.C4H10O2/c1-11(2)8-13-4-6-14(7-5-13)9-12(3)10-15;1-4(5-2)6-3/h4-7,10-12H,8-9H2,1-3H3;4H,1-3H3 |
| InChIKey | QIZHRBSCUWQQEC-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.44 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|