About [(2R)-3-carbamoyloxy-2-fluoro-4,4-dimethylpentyl] methanesulfonate
[(2R)-3-carbamoyloxy-2-fluoro-4,4-dimethylpentyl] methanesulfonate (PubChem CID 87383330) has the molecular formula C9H18FNO5S
and a molecular weight of 271.31 g/mol. Its IUPAC name is [(2R)-3-carbamoyloxy-2-fluoro-4,4-dimethylpentyl] methanesulfonate.
Molecular Properties
| Compound Name | [(2R)-3-carbamoyloxy-2-fluoro-4,4-dimethylpentyl] methanesulfonate |
| PubChem CID | 87383330 |
| Molecular Formula | C9H18FNO5S |
| Molecular Weight | 271.31 g/mol |
| Exact Mass | 271.09 |
| IUPAC Name | [(2R)-3-carbamoyloxy-2-fluoro-4,4-dimethylpentyl] methanesulfonate |
| SMILES | CC(C)(C)C(OC(N)=O)[C@H](F)COS(C)(=O)=O |
| InChI | InChI=1S/C9H18FNO5S/c1-9(2,3)7(16-8(11)12)6(10)5-15-17(4,13)14/h6-7H,5H2,1-4H3,(H2,11,12)/t6-,7?/m1/s1 |
| InChIKey | ONCVZLCEALFMPC-ULUSZKPHSA-N |
| XLogP | 0.81 |
| TPSA | 95.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.31 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze [(2R)-3-carbamoyloxy-2-fluoro-4,4-dimethylpentyl] methanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2R)-3-carbamoyloxy-2-fluoro-4,4-dimethylpentyl] methanesulfonate?
The IUPAC name of [(2R)-3-carbamoyloxy-2-fluoro-4,4-dimethylpentyl] methanesulfonate (CID 87383330) is [(2R)-3-carbamoyloxy-2-fluoro-4,4-dimethylpentyl] methanesulfonate.
What is the SMILES notation for [(2R)-3-carbamoyloxy-2-fluoro-4,4-dimethylpentyl] methanesulfonate?
The canonical SMILES for [(2R)-3-carbamoyloxy-2-fluoro-4,4-dimethylpentyl] methanesulfonate is CC(C)(C)C(OC(N)=O)[C@H](F)COS(C)(=O)=O.
What is the InChIKey of [(2R)-3-carbamoyloxy-2-fluoro-4,4-dimethylpentyl] methanesulfonate?
The InChIKey is ONCVZLCEALFMPC-ULUSZKPHSA-N. The full InChI is InChI=1S/C9H18FNO5S/c1-9(2,3)7(16-8(11)12)6(10)5-15-17(4,13)14/h6-7H,5H2,1-4H3,(H2,11,12)/t6-,7?/m1/s1.
What are the key properties of [(2R)-3-carbamoyloxy-2-fluoro-4,4-dimethylpentyl] methanesulfonate?
[(2R)-3-carbamoyloxy-2-fluoro-4,4-dimethylpentyl] methanesulfonate has a molecular weight of 271.31 g/mol, XLogP of 0.81, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [(2R)-3-carbamoyloxy-2-fluoro-4,4-dimethylpentyl] methanesulfonate is sourced from PubChem (CID 87383330), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).