About oxo-trimethylsilyl-trimethylsilyloxyphosphanium
oxo-trimethylsilyl-trimethylsilyloxyphosphanium (PubChem CID 87383446) has the molecular formula C6H18O2PSi2+
and a molecular weight of 209.35 g/mol. Its IUPAC name is oxo-trimethylsilyl-trimethylsilyloxyphosphanium.
Molecular Properties
| Compound Name | oxo-trimethylsilyl-trimethylsilyloxyphosphanium |
| PubChem CID | 87383446 |
| Molecular Formula | C6H18O2PSi2+ |
| Molecular Weight | 209.35 g/mol |
| Exact Mass | 209.06 |
| IUPAC Name | oxo-trimethylsilyl-trimethylsilyloxyphosphanium |
| SMILES | C[Si](C)(C)O[P+](=O)[Si](C)(C)C |
| InChI | InChI=1S/C6H18O2PSi2/c1-10(2,3)8-9(7)11(4,5)6/h1-6H3/q+1 |
| InChIKey | ANFLVROZVQIQOD-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.35 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze oxo-trimethylsilyl-trimethylsilyloxyphosphanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of oxo-trimethylsilyl-trimethylsilyloxyphosphanium?
The IUPAC name of oxo-trimethylsilyl-trimethylsilyloxyphosphanium (CID 87383446) is oxo-trimethylsilyl-trimethylsilyloxyphosphanium.
What is the SMILES notation for oxo-trimethylsilyl-trimethylsilyloxyphosphanium?
The canonical SMILES for oxo-trimethylsilyl-trimethylsilyloxyphosphanium is C[Si](C)(C)O[P+](=O)[Si](C)(C)C.
What is the InChIKey of oxo-trimethylsilyl-trimethylsilyloxyphosphanium?
The InChIKey is ANFLVROZVQIQOD-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H18O2PSi2/c1-10(2,3)8-9(7)11(4,5)6/h1-6H3/q+1.
What are the key properties of oxo-trimethylsilyl-trimethylsilyloxyphosphanium?
oxo-trimethylsilyl-trimethylsilyloxyphosphanium has a molecular weight of 209.35 g/mol, XLogP of 3.42, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for oxo-trimethylsilyl-trimethylsilyloxyphosphanium is sourced from PubChem (CID 87383446), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).