C11H6F12O4 — CID 87383703
2,2-bis(1,1,1,2,3,3-hexafluoropropan-2-yl)-3-methylidenebutanedioic acid (PubChem CID 87383703) has the molecular formula C11H6F12O4 and a molecular weight of 430.14 g/mol. Its IUPAC name is 2,2-bis(1,1,1,2,3,3-hexafluoropropan-2-yl)-3-methylidenebutanedioic acid.
| Compound Name | 2,2-bis(1,1,1,2,3,3-hexafluoropropan-2-yl)-3-methylidenebutanedioic acid |
|---|---|
| PubChem CID | 87383703 |
| Molecular Formula | C11H6F12O4 |
| Molecular Weight | 430.14 g/mol |
| Exact Mass | 430.01 |
| IUPAC Name | 2,2-bis(1,1,1,2,3,3-hexafluoropropan-2-yl)-3-methylidenebutanedioic acid |
| SMILES | C=C(C(=O)O)C(C(=O)O)(C(F)(C(F)F)C(F)(F)F)C(F)(C(F)F)C(F)(F)F |
| InChI | InChI=1S/C11H6F12O4/c1-2(3(24)25)7(6(26)27,8(16,4(12)13)10(18,19)20)9(17,5(14)15)11(21,22)23/h4-5H,1H2,(H,24,25)(H,26,27) |
| InChIKey | NSBGPKSRIIJASW-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.14 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|