About 2-oxoethyl 2-oxopropanoate
2-oxoethyl 2-oxopropanoate (PubChem CID 87383810) has the molecular formula C5H6O4
and a molecular weight of 130.10 g/mol. Its IUPAC name is 2-oxoethyl 2-oxopropanoate.
Molecular Properties
| Compound Name | 2-oxoethyl 2-oxopropanoate |
| PubChem CID | 87383810 |
| Molecular Formula | C5H6O4 |
| Molecular Weight | 130.10 g/mol |
| Exact Mass | 130.03 |
| IUPAC Name | 2-oxoethyl 2-oxopropanoate |
| SMILES | CC(=O)C(=O)OCC=O |
| InChI | InChI=1S/C5H6O4/c1-4(7)5(8)9-3-2-6/h2H,3H2,1H3 |
| InChIKey | JQZIMULKJBYVEJ-UHFFFAOYSA-N |
| XLogP | -0.68 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 130.10 |
| LogP ≤ 5 | -0.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze 2-oxoethyl 2-oxopropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-oxoethyl 2-oxopropanoate?
The IUPAC name of 2-oxoethyl 2-oxopropanoate (CID 87383810) is 2-oxoethyl 2-oxopropanoate.
What is the SMILES notation for 2-oxoethyl 2-oxopropanoate?
The canonical SMILES for 2-oxoethyl 2-oxopropanoate is CC(=O)C(=O)OCC=O.
What is the InChIKey of 2-oxoethyl 2-oxopropanoate?
The InChIKey is JQZIMULKJBYVEJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H6O4/c1-4(7)5(8)9-3-2-6/h2H,3H2,1H3.
What are the key properties of 2-oxoethyl 2-oxopropanoate?
2-oxoethyl 2-oxopropanoate has a molecular weight of 130.10 g/mol, XLogP of -0.68, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-oxoethyl 2-oxopropanoate is sourced from PubChem (CID 87383810), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).