C12H14ClN3OS — CID 87384519
[(1R,2R)-2-(6-chloro-3-pyridinyl)cyclopentyl]-cyano-[methyl(oxido)-λ4-sulfanylidene]azanium (PubChem CID 87384519) has the molecular formula C12H14ClN3OS and a molecular weight of 283.78 g/mol. Its IUPAC name is [(1R,2R)-2-(6-chloro-3-pyridinyl)cyclopentyl]-cyano-[methyl(oxido)-λ4-sulfanylidene]azanium.
| Compound Name | [(1R,2R)-2-(6-chloro-3-pyridinyl)cyclopentyl]-cyano-[methyl(oxido)-λ4-sulfanylidene]azanium |
|---|---|
| PubChem CID | 87384519 |
| Molecular Formula | C12H14ClN3OS |
| Molecular Weight | 283.78 g/mol |
| Exact Mass | 283.05 |
| IUPAC Name | [(1R,2R)-2-(6-chloro-3-pyridinyl)cyclopentyl]-cyano-[methyl(oxido)-λ4-sulfanylidene]azanium |
| SMILES | C/S([O-])=[N+](/C#N)[C@@H]1CCC[C@@H]1c1ccc(Cl)nc1 |
| InChI | InChI=1S/C12H14ClN3OS/c1-18(17)16(8-14)11-4-2-3-10(11)9-5-6-12(13)15-7-9/h5-7,10-11H,2-4H2,1H3/t10-,11-,18?/m1/s1 |
| InChIKey | UOHAFNUTRDYZAF-LSSOAPJISA-N |
| XLogP | 2.43 |
| TPSA | 62.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.78 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|