C24H35F3N4O3S2 — CID 87384594
(2,2,2-trifluoroacetyl) 2-[[4-[2-[heptyl-(5-propyl-1H-pyrazol-3-yl)amino]ethyl]-1,3-thiazol-2-yl]sulfanyl]-2-methylpropanoate (PubChem CID 87384594) has the molecular formula C24H35F3N4O3S2 and a molecular weight of 548.70 g/mol. Its IUPAC name is (2,2,2-trifluoroacetyl) 2-[[4-[2-[heptyl-(5-propyl-1H-pyrazol-3-yl)amino]ethyl]-1,3-thiazol-2-yl]sulfanyl]-2-methylpropanoate.
| Compound Name | (2,2,2-trifluoroacetyl) 2-[[4-[2-[heptyl-(5-propyl-1H-pyrazol-3-yl)amino]ethyl]-1,3-thiazol-2-yl]sulfanyl]-2-methylpropanoate |
|---|---|
| PubChem CID | 87384594 |
| Molecular Formula | C24H35F3N4O3S2 |
| Molecular Weight | 548.70 g/mol |
| Exact Mass | 548.21 |
| IUPAC Name | (2,2,2-trifluoroacetyl) 2-[[4-[2-[heptyl-(5-propyl-1H-pyrazol-3-yl)amino]ethyl]-1,3-thiazol-2-yl]sulfanyl]-2-methylpropanoate |
| SMILES | CCCCCCCN(CCc1csc(SC(C)(C)C(=O)OC(=O)C(F)(F)F)n1)c1cc(CCC)[nH]n1 |
| InChI | InChI=1S/C24H35F3N4O3S2/c1-5-7-8-9-10-13-31(19-15-17(11-6-2)29-30-19)14-12-18-16-35-22(28-18)36-23(3,4)20(32)34-21(33)24(25,26)27/h15-16H,5-14H2,1-4H3,(H,29,30) |
| InChIKey | HCJSSTUNLBUJAC-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 88.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.70 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|