About 2-[3-(3H-1,3-benzothiazol-2-ylidene)prop-1-enyl]-3-methyl-1,3-benzothiazol-3-ium iodide
2-[3-(3H-1,3-benzothiazol-2-ylidene)prop-1-enyl]-3-methyl-1,3-benzothiazol-3-ium iodide (PubChem CID 87384760) has the molecular formula C18H15IN2S2
and a molecular weight of 450.37 g/mol. Its IUPAC name is 2-[3-(3H-1,3-benzothiazol-2-ylidene)prop-1-enyl]-3-methyl-1,3-benzothiazol-3-ium iodide.
Molecular Properties
| Compound Name | 2-[3-(3H-1,3-benzothiazol-2-ylidene)prop-1-enyl]-3-methyl-1,3-benzothiazol-3-ium iodide |
| PubChem CID | 87384760 |
| Molecular Formula | C18H15IN2S2 |
| Molecular Weight | 450.37 g/mol |
| Exact Mass | 449.97 |
| IUPAC Name | 2-[3-(3H-1,3-benzothiazol-2-ylidene)prop-1-enyl]-3-methyl-1,3-benzothiazol-3-ium iodide |
| SMILES | C[n+]1c(C=CC=C2Nc3ccccc3S2)sc2ccccc21.[I-] |
| InChI | InChI=1S/C18H14N2S2.HI/c1-20-14-8-3-5-10-16(14)22-18(20)12-6-11-17-19-13-7-2-4-9-15(13)21-17;/h2-12H,1H3;1H |
| InChIKey | CIIZGANGVCGNNK-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 15.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 450.37 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 2-[3-(3H-1,3-benzothiazol-2-ylidene)prop-1-enyl]-3-methyl-1,3-benzothiazol-3-ium iodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[3-(3H-1,3-benzothiazol-2-ylidene)prop-1-enyl]-3-methyl-1,3-benzothiazol-3-ium iodide?
The IUPAC name of 2-[3-(3H-1,3-benzothiazol-2-ylidene)prop-1-enyl]-3-methyl-1,3-benzothiazol-3-ium iodide (CID 87384760) is 2-[3-(3H-1,3-benzothiazol-2-ylidene)prop-1-enyl]-3-methyl-1,3-benzothiazol-3-ium iodide.
What is the SMILES notation for 2-[3-(3H-1,3-benzothiazol-2-ylidene)prop-1-enyl]-3-methyl-1,3-benzothiazol-3-ium iodide?
The canonical SMILES for 2-[3-(3H-1,3-benzothiazol-2-ylidene)prop-1-enyl]-3-methyl-1,3-benzothiazol-3-ium iodide is C[n+]1c(C=CC=C2Nc3ccccc3S2)sc2ccccc21.[I-].
What is the InChIKey of 2-[3-(3H-1,3-benzothiazol-2-ylidene)prop-1-enyl]-3-methyl-1,3-benzothiazol-3-ium iodide?
The InChIKey is CIIZGANGVCGNNK-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H14N2S2.HI/c1-20-14-8-3-5-10-16(14)22-18(20)12-6-11-17-19-13-7-2-4-9-15(13)21-17;/h2-12H,1H3;1H.
What are the key properties of 2-[3-(3H-1,3-benzothiazol-2-ylidene)prop-1-enyl]-3-methyl-1,3-benzothiazol-3-ium iodide?
2-[3-(3H-1,3-benzothiazol-2-ylidene)prop-1-enyl]-3-methyl-1,3-benzothiazol-3-ium iodide has a molecular weight of 450.37 g/mol, XLogP of 1.80, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3-(3H-1,3-benzothiazol-2-ylidene)prop-1-enyl]-3-methyl-1,3-benzothiazol-3-ium iodide is sourced from PubChem (CID 87384760), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).