C26H36F3N5O3S2 — CID 87384761
(2,2,2-trifluoroacetyl) 2-[[4-[2-[heptyl-(5-pyrrolidin-1-ylpyrimidin-2-yl)amino]ethyl]-1,3-thiazol-2-yl]sulfanyl]-2-methylpropanoate (PubChem CID 87384761) has the molecular formula C26H36F3N5O3S2 and a molecular weight of 587.73 g/mol. Its IUPAC name is (2,2,2-trifluoroacetyl) 2-[[4-[2-[heptyl-(5-pyrrolidin-1-ylpyrimidin-2-yl)amino]ethyl]-1,3-thiazol-2-yl]sulfanyl]-2-methylpropanoate.
| Compound Name | (2,2,2-trifluoroacetyl) 2-[[4-[2-[heptyl-(5-pyrrolidin-1-ylpyrimidin-2-yl)amino]ethyl]-1,3-thiazol-2-yl]sulfanyl]-2-methylpropanoate |
|---|---|
| PubChem CID | 87384761 |
| Molecular Formula | C26H36F3N5O3S2 |
| Molecular Weight | 587.73 g/mol |
| Exact Mass | 587.22 |
| IUPAC Name | (2,2,2-trifluoroacetyl) 2-[[4-[2-[heptyl-(5-pyrrolidin-1-ylpyrimidin-2-yl)amino]ethyl]-1,3-thiazol-2-yl]sulfanyl]-2-methylpropanoate |
| SMILES | CCCCCCCN(CCc1csc(SC(C)(C)C(=O)OC(=O)C(F)(F)F)n1)c1ncc(N2CCCC2)cn1 |
| InChI | InChI=1S/C26H36F3N5O3S2/c1-4-5-6-7-8-14-34(23-30-16-20(17-31-23)33-12-9-10-13-33)15-11-19-18-38-24(32-19)39-25(2,3)21(35)37-22(36)26(27,28)29/h16-18H,4-15H2,1-3H3 |
| InChIKey | MYTBOOJHQBTCDR-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 88.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.73 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|