C24H34F3N5O3S2 — CID 87385046
(2,2,2-trifluoroacetyl) 2-[[4-[2-[[5-(dimethylamino)pyrimidin-2-yl]-heptylamino]ethyl]-1,3-thiazol-2-yl]sulfanyl]-2-methylpropanoate (PubChem CID 87385046) has the molecular formula C24H34F3N5O3S2 and a molecular weight of 561.70 g/mol. Its IUPAC name is (2,2,2-trifluoroacetyl) 2-[[4-[2-[[5-(dimethylamino)pyrimidin-2-yl]-heptylamino]ethyl]-1,3-thiazol-2-yl]sulfanyl]-2-methylpropanoate.
| Compound Name | (2,2,2-trifluoroacetyl) 2-[[4-[2-[[5-(dimethylamino)pyrimidin-2-yl]-heptylamino]ethyl]-1,3-thiazol-2-yl]sulfanyl]-2-methylpropanoate |
|---|---|
| PubChem CID | 87385046 |
| Molecular Formula | C24H34F3N5O3S2 |
| Molecular Weight | 561.70 g/mol |
| Exact Mass | 561.21 |
| IUPAC Name | (2,2,2-trifluoroacetyl) 2-[[4-[2-[[5-(dimethylamino)pyrimidin-2-yl]-heptylamino]ethyl]-1,3-thiazol-2-yl]sulfanyl]-2-methylpropanoate |
| SMILES | CCCCCCCN(CCc1csc(SC(C)(C)C(=O)OC(=O)C(F)(F)F)n1)c1ncc(N(C)C)cn1 |
| InChI | InChI=1S/C24H34F3N5O3S2/c1-6-7-8-9-10-12-32(21-28-14-18(15-29-21)31(4)5)13-11-17-16-36-22(30-17)37-23(2,3)19(33)35-20(34)24(25,26)27/h14-16H,6-13H2,1-5H3 |
| InChIKey | UGCHFUNCRKQIIA-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 88.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.70 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|