About N-[1-(5,6-diamino-2-pyridinyl)-4-hydroxypyrrolidin-2-yl]formamide
N-[1-(5,6-diamino-2-pyridinyl)-4-hydroxypyrrolidin-2-yl]formamide (PubChem CID 87385110) has the molecular formula C10H15N5O2
and a molecular weight of 237.26 g/mol. Its IUPAC name is N-[1-(5,6-diamino-2-pyridinyl)-4-hydroxypyrrolidin-2-yl]formamide.
Molecular Properties
| Compound Name | N-[1-(5,6-diamino-2-pyridinyl)-4-hydroxypyrrolidin-2-yl]formamide |
| PubChem CID | 87385110 |
| Molecular Formula | C10H15N5O2 |
| Molecular Weight | 237.26 g/mol |
| Exact Mass | 237.12 |
| IUPAC Name | N-[1-(5,6-diamino-2-pyridinyl)-4-hydroxypyrrolidin-2-yl]formamide |
| SMILES | Nc1ccc(N2CC(O)CC2NC=O)nc1N |
| InChI | InChI=1S/C10H15N5O2/c11-7-1-2-8(14-10(7)12)15-4-6(17)3-9(15)13-5-16/h1-2,5-6,9,17H,3-4,11H2,(H2,12,14)(H,13,16) |
| InChIKey | JNGDPGCLWZCPDH-UHFFFAOYSA-N |
| XLogP | -1.11 |
| TPSA | 117.50 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.26 |
| LogP ≤ 5 | -1.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze N-[1-(5,6-diamino-2-pyridinyl)-4-hydroxypyrrolidin-2-yl]formamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[1-(5,6-diamino-2-pyridinyl)-4-hydroxypyrrolidin-2-yl]formamide?
The IUPAC name of N-[1-(5,6-diamino-2-pyridinyl)-4-hydroxypyrrolidin-2-yl]formamide (CID 87385110) is N-[1-(5,6-diamino-2-pyridinyl)-4-hydroxypyrrolidin-2-yl]formamide.
What is the SMILES notation for N-[1-(5,6-diamino-2-pyridinyl)-4-hydroxypyrrolidin-2-yl]formamide?
The canonical SMILES for N-[1-(5,6-diamino-2-pyridinyl)-4-hydroxypyrrolidin-2-yl]formamide is Nc1ccc(N2CC(O)CC2NC=O)nc1N.
What is the InChIKey of N-[1-(5,6-diamino-2-pyridinyl)-4-hydroxypyrrolidin-2-yl]formamide?
The InChIKey is JNGDPGCLWZCPDH-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15N5O2/c11-7-1-2-8(14-10(7)12)15-4-6(17)3-9(15)13-5-16/h1-2,5-6,9,17H,3-4,11H2,(H2,12,14)(H,13,16).
What are the key properties of N-[1-(5,6-diamino-2-pyridinyl)-4-hydroxypyrrolidin-2-yl]formamide?
N-[1-(5,6-diamino-2-pyridinyl)-4-hydroxypyrrolidin-2-yl]formamide has a molecular weight of 237.26 g/mol, XLogP of -1.11, 3 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-[1-(5,6-diamino-2-pyridinyl)-4-hydroxypyrrolidin-2-yl]formamide is sourced from PubChem (CID 87385110), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).