C26H36N4O7S — CID 87385672
tert-butyl N-[5-[[1-[2-[(E)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]-4,5-dimethoxyphenyl]pyrrolidin-3-yl]amino]-5-oxopentyl]carbamate (PubChem CID 87385672) has the molecular formula C26H36N4O7S and a molecular weight of 548.66 g/mol. Its IUPAC name is tert-butyl N-[5-[[1-[2-[(E)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]-4,5-dimethoxyphenyl]pyrrolidin-3-yl]amino]-5-oxopentyl]carbamate.
| Compound Name | tert-butyl N-[5-[[1-[2-[(E)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]-4,5-dimethoxyphenyl]pyrrolidin-3-yl]amino]-5-oxopentyl]carbamate |
|---|---|
| PubChem CID | 87385672 |
| Molecular Formula | C26H36N4O7S |
| Molecular Weight | 548.66 g/mol |
| Exact Mass | 548.23 |
| IUPAC Name | tert-butyl N-[5-[[1-[2-[(E)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]-4,5-dimethoxyphenyl]pyrrolidin-3-yl]amino]-5-oxopentyl]carbamate |
| SMILES | COc1cc(/C=C2/SC(=O)NC2=O)c(N2CCC(NC(=O)CCCCNC(=O)OC(C)(C)C)C2)cc1OC |
| InChI | InChI=1S/C26H36N4O7S/c1-26(2,3)37-24(33)27-10-7-6-8-22(31)28-17-9-11-30(15-17)18-14-20(36-5)19(35-4)12-16(18)13-21-23(32)29-25(34)38-21/h12-14,17H,6-11,15H2,1-5H3,(H,27,33)(H,28,31)(H,29,32,34)/b21-13+ |
| InChIKey | SGYCJXIZCABXOB-FYJGNVAPSA-N |
| XLogP | 3.42 |
| TPSA | 135.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.66 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|