C24H21Cl2F2N5O2 — CID 87386039
7-[2-(2,6-dichloro-3,5-difluorophenyl)ethoxy]-3-(6-piperazin-1-yl-3-pyridinyl)furo[3,2-c]pyridin-6-amine (PubChem CID 87386039) has the molecular formula C24H21Cl2F2N5O2 and a molecular weight of 520.37 g/mol. Its IUPAC name is 7-[2-(2,6-dichloro-3,5-difluorophenyl)ethoxy]-3-(6-piperazin-1-yl-3-pyridinyl)furo[3,2-c]pyridin-6-amine.
| Compound Name | 7-[2-(2,6-dichloro-3,5-difluorophenyl)ethoxy]-3-(6-piperazin-1-yl-3-pyridinyl)furo[3,2-c]pyridin-6-amine |
|---|---|
| PubChem CID | 87386039 |
| Molecular Formula | C24H21Cl2F2N5O2 |
| Molecular Weight | 520.37 g/mol |
| Exact Mass | 519.10 |
| IUPAC Name | 7-[2-(2,6-dichloro-3,5-difluorophenyl)ethoxy]-3-(6-piperazin-1-yl-3-pyridinyl)furo[3,2-c]pyridin-6-amine |
| SMILES | Nc1ncc2c(-c3ccc(N4CCNCC4)nc3)coc2c1OCCc1c(Cl)c(F)cc(F)c1Cl |
| InChI | InChI=1S/C24H21Cl2F2N5O2/c25-20-14(21(26)18(28)9-17(20)27)3-8-34-23-22-15(11-32-24(23)29)16(12-35-22)13-1-2-19(31-10-13)33-6-4-30-5-7-33/h1-2,9-12,30H,3-8H2,(H2,29,32) |
| InChIKey | XRKUFGYPAAWZIQ-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 89.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.37 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|