C20H27ClN4O3S — CID 87386056
(5Z)-5-[[2-[4-(5-aminopentanoyl)-1,4-diazepan-1-yl]phenyl]methylidene]-1,3-thiazolidine-2,4-dione;hydrochloride (PubChem CID 87386056) has the molecular formula C20H27ClN4O3S and a molecular weight of 438.98 g/mol. Its IUPAC name is (5Z)-5-[[2-[4-(5-aminopentanoyl)-1,4-diazepan-1-yl]phenyl]methylidene]-1,3-thiazolidine-2,4-dione;hydrochloride.
| Compound Name | (5Z)-5-[[2-[4-(5-aminopentanoyl)-1,4-diazepan-1-yl]phenyl]methylidene]-1,3-thiazolidine-2,4-dione;hydrochloride |
|---|---|
| PubChem CID | 87386056 |
| Molecular Formula | C20H27ClN4O3S |
| Molecular Weight | 438.98 g/mol |
| Exact Mass | 438.15 |
| IUPAC Name | (5Z)-5-[[2-[4-(5-aminopentanoyl)-1,4-diazepan-1-yl]phenyl]methylidene]-1,3-thiazolidine-2,4-dione;hydrochloride |
| SMILES | Cl.NCCCCC(=O)N1CCCN(c2ccccc2/C=C2\SC(=O)NC2=O)CC1 |
| InChI | InChI=1S/C20H26N4O3S.ClH/c21-9-4-3-8-18(25)24-11-5-10-23(12-13-24)16-7-2-1-6-15(16)14-17-19(26)22-20(27)28-17;/h1-2,6-7,14H,3-5,8-13,21H2,(H,22,26,27);1H/b17-14-; |
| InChIKey | CJUZEFBCQHDLSP-SBBUSYCLSA-N |
| XLogP | 2.60 |
| TPSA | 95.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.98 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|