C44H46Br2N4O8S3 — CID 87386141
6,7-bis[4-[2-[2-[2-(2-bromoethoxy)ethoxy]ethoxy]ethoxy]phenyl]-4,9-dithiophen-2-yl-[1,2,5]thiadiazolo[3,4-g]quinoxaline (PubChem CID 87386141) has the molecular formula C44H46Br2N4O8S3 and a molecular weight of 1014.88 g/mol. Its IUPAC name is 6,7-bis[4-[2-[2-[2-(2-bromoethoxy)ethoxy]ethoxy]ethoxy]phenyl]-4,9-dithiophen-2-yl-[1,2,5]thiadiazolo[3,4-g]quinoxaline.
| Compound Name | 6,7-bis[4-[2-[2-[2-(2-bromoethoxy)ethoxy]ethoxy]ethoxy]phenyl]-4,9-dithiophen-2-yl-[1,2,5]thiadiazolo[3,4-g]quinoxaline |
|---|---|
| PubChem CID | 87386141 |
| Molecular Formula | C44H46Br2N4O8S3 |
| Molecular Weight | 1014.88 g/mol |
| Exact Mass | 1012.08 |
| IUPAC Name | 6,7-bis[4-[2-[2-[2-(2-bromoethoxy)ethoxy]ethoxy]ethoxy]phenyl]-4,9-dithiophen-2-yl-[1,2,5]thiadiazolo[3,4-g]quinoxaline |
| SMILES | BrCCOCCOCCOCCOc1ccc(-c2nc3c(-c4cccs4)c4nsnc4c(-c4cccs4)c3nc2-c2ccc(OCCOCCOCCOCCBr)cc2)cc1 |
| InChI | InChI=1S/C44H46Br2N4O8S3/c45-13-15-51-17-19-53-21-23-55-25-27-57-33-9-5-31(6-10-33)39-40(32-7-11-34(12-8-32)58-28-26-56-24-22-54-20-18-52-16-14-46)48-42-38(36-4-2-30-60-36)44-43(49-61-50-44)37(41(42)47-39)35-3-1-29-59-35/h1-12,29-30H,13-28H2 |
| InChIKey | GLAFUDSULGLSMN-UHFFFAOYSA-N |
| XLogP | 10.07 |
| TPSA | 125.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 61 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1014.88 |
| LogP ≤ 5 | 10.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|