About 2-(anthracene-9-carbonyloxy)-1,1-difluoroethanesulfonic acid;benzhydrylsulfanylbenzene
2-(anthracene-9-carbonyloxy)-1,1-difluoroethanesulfonic acid;benzhydrylsulfanylbenzene (PubChem CID 87386204) has the molecular formula C36H28F2O5S2
and a molecular weight of 642.75 g/mol. Its IUPAC name is 2-(anthracene-9-carbonyloxy)-1,1-difluoroethanesulfonic acid;benzhydrylsulfanylbenzene.
Molecular Properties
| Compound Name | 2-(anthracene-9-carbonyloxy)-1,1-difluoroethanesulfonic acid;benzhydrylsulfanylbenzene |
| PubChem CID | 87386204 |
| Molecular Formula | C36H28F2O5S2 |
| Molecular Weight | 642.75 g/mol |
| Exact Mass | 642.13 |
| IUPAC Name | 2-(anthracene-9-carbonyloxy)-1,1-difluoroethanesulfonic acid;benzhydrylsulfanylbenzene |
| SMILES | O=C(OCC(F)(F)S(=O)(=O)O)c1c2ccccc2cc2ccccc12.c1ccc(SC(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C19H16S.C17H12F2O5S/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)20-18-14-8-3-9-15-18;18-17(19,25(21,22)23)10-24-16(20)15-13-7-3-1-5-11(13)9-12-6-2-4-8-14(12)15/h1-15,19H;1-9H,10H2,(H,21,22,23) |
| InChIKey | GCTXKBPOHVODLJ-UHFFFAOYSA-N |
| XLogP | 9.20 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 642.75 |
| LogP ≤ 5 | 9.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 2-(anthracene-9-carbonyloxy)-1,1-difluoroethanesulfonic acid;benzhydrylsulfanylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(anthracene-9-carbonyloxy)-1,1-difluoroethanesulfonic acid;benzhydrylsulfanylbenzene?
The IUPAC name of 2-(anthracene-9-carbonyloxy)-1,1-difluoroethanesulfonic acid;benzhydrylsulfanylbenzene (CID 87386204) is 2-(anthracene-9-carbonyloxy)-1,1-difluoroethanesulfonic acid;benzhydrylsulfanylbenzene.
What is the SMILES notation for 2-(anthracene-9-carbonyloxy)-1,1-difluoroethanesulfonic acid;benzhydrylsulfanylbenzene?
The canonical SMILES for 2-(anthracene-9-carbonyloxy)-1,1-difluoroethanesulfonic acid;benzhydrylsulfanylbenzene is O=C(OCC(F)(F)S(=O)(=O)O)c1c2ccccc2cc2ccccc12.c1ccc(SC(c2ccccc2)c2ccccc2)cc1.
What is the InChIKey of 2-(anthracene-9-carbonyloxy)-1,1-difluoroethanesulfonic acid;benzhydrylsulfanylbenzene?
The InChIKey is GCTXKBPOHVODLJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H16S.C17H12F2O5S/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)20-18-14-8-3-9-15-18;18-17(19,25(21,22)23)10-24-16(20)15-13-7-3-1-5-11(13)9-12-6-2-4-8-14(12)15/h1-15,19H;1-9H,10H2,(H,21,22,23).
What are the key properties of 2-(anthracene-9-carbonyloxy)-1,1-difluoroethanesulfonic acid;benzhydrylsulfanylbenzene?
2-(anthracene-9-carbonyloxy)-1,1-difluoroethanesulfonic acid;benzhydrylsulfanylbenzene has a molecular weight of 642.75 g/mol, XLogP of 9.20, 8 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(anthracene-9-carbonyloxy)-1,1-difluoroethanesulfonic acid;benzhydrylsulfanylbenzene is sourced from PubChem (CID 87386204), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).