About benzhydrylsulfanylbenzene;1,1-difluoro-2-(2-phenoxyacetyl)oxyethanesulfonic acid
benzhydrylsulfanylbenzene;1,1-difluoro-2-(2-phenoxyacetyl)oxyethanesulfonic acid (PubChem CID 87386427) has the molecular formula C29H26F2O6S2
and a molecular weight of 572.65 g/mol. Its IUPAC name is benzhydrylsulfanylbenzene;1,1-difluoro-2-(2-phenoxyacetyl)oxyethanesulfonic acid.
Molecular Properties
| Compound Name | benzhydrylsulfanylbenzene;1,1-difluoro-2-(2-phenoxyacetyl)oxyethanesulfonic acid |
| PubChem CID | 87386427 |
| Molecular Formula | C29H26F2O6S2 |
| Molecular Weight | 572.65 g/mol |
| Exact Mass | 572.11 |
| IUPAC Name | benzhydrylsulfanylbenzene;1,1-difluoro-2-(2-phenoxyacetyl)oxyethanesulfonic acid |
| SMILES | O=C(COc1ccccc1)OCC(F)(F)S(=O)(=O)O.c1ccc(SC(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C19H16S.C10H10F2O6S/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)20-18-14-8-3-9-15-18;11-10(12,19(14,15)16)7-18-9(13)6-17-8-4-2-1-3-5-8/h1-15,19H;1-5H,6-7H2,(H,14,15,16) |
| InChIKey | HEIPADRYPWHJOP-UHFFFAOYSA-N |
| XLogP | 6.66 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 572.65 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze benzhydrylsulfanylbenzene;1,1-difluoro-2-(2-phenoxyacetyl)oxyethanesulfonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzhydrylsulfanylbenzene;1,1-difluoro-2-(2-phenoxyacetyl)oxyethanesulfonic acid?
The IUPAC name of benzhydrylsulfanylbenzene;1,1-difluoro-2-(2-phenoxyacetyl)oxyethanesulfonic acid (CID 87386427) is benzhydrylsulfanylbenzene;1,1-difluoro-2-(2-phenoxyacetyl)oxyethanesulfonic acid.
What is the SMILES notation for benzhydrylsulfanylbenzene;1,1-difluoro-2-(2-phenoxyacetyl)oxyethanesulfonic acid?
The canonical SMILES for benzhydrylsulfanylbenzene;1,1-difluoro-2-(2-phenoxyacetyl)oxyethanesulfonic acid is O=C(COc1ccccc1)OCC(F)(F)S(=O)(=O)O.c1ccc(SC(c2ccccc2)c2ccccc2)cc1.
What is the InChIKey of benzhydrylsulfanylbenzene;1,1-difluoro-2-(2-phenoxyacetyl)oxyethanesulfonic acid?
The InChIKey is HEIPADRYPWHJOP-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H16S.C10H10F2O6S/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)20-18-14-8-3-9-15-18;11-10(12,19(14,15)16)7-18-9(13)6-17-8-4-2-1-3-5-8/h1-15,19H;1-5H,6-7H2,(H,14,15,16).
What are the key properties of benzhydrylsulfanylbenzene;1,1-difluoro-2-(2-phenoxyacetyl)oxyethanesulfonic acid?
benzhydrylsulfanylbenzene;1,1-difluoro-2-(2-phenoxyacetyl)oxyethanesulfonic acid has a molecular weight of 572.65 g/mol, XLogP of 6.66, 10 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for benzhydrylsulfanylbenzene;1,1-difluoro-2-(2-phenoxyacetyl)oxyethanesulfonic acid is sourced from PubChem (CID 87386427), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).