About 1,1-difluoro-2-(2-phenoxyacetyl)oxyethanesulfonic acid;(2-methylphenyl)-diphenylsulfanium
1,1-difluoro-2-(2-phenoxyacetyl)oxyethanesulfonic acid;(2-methylphenyl)-diphenylsulfanium (PubChem CID 87386428) has the molecular formula C29H27F2O6S2+
and a molecular weight of 573.66 g/mol. Its IUPAC name is 1,1-difluoro-2-(2-phenoxyacetyl)oxyethanesulfonic acid;(2-methylphenyl)-diphenylsulfanium.
Molecular Properties
| Compound Name | 1,1-difluoro-2-(2-phenoxyacetyl)oxyethanesulfonic acid;(2-methylphenyl)-diphenylsulfanium |
| PubChem CID | 87386428 |
| Molecular Formula | C29H27F2O6S2+ |
| Molecular Weight | 573.66 g/mol |
| Exact Mass | 573.12 |
| IUPAC Name | 1,1-difluoro-2-(2-phenoxyacetyl)oxyethanesulfonic acid;(2-methylphenyl)-diphenylsulfanium |
| SMILES | Cc1ccccc1[S+](c1ccccc1)c1ccccc1.O=C(COc1ccccc1)OCC(F)(F)S(=O)(=O)O |
| InChI | InChI=1S/C19H17S.C10H10F2O6S/c1-16-10-8-9-15-19(16)20(17-11-4-2-5-12-17)18-13-6-3-7-14-18;11-10(12,19(14,15)16)7-18-9(13)6-17-8-4-2-1-3-5-8/h2-15H,1H3;1-5H,6-7H2,(H,14,15,16)/q+1; |
| InChIKey | KNCCFLULUBSBFC-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 573.66 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 1,1-difluoro-2-(2-phenoxyacetyl)oxyethanesulfonic acid;(2-methylphenyl)-diphenylsulfanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1-difluoro-2-(2-phenoxyacetyl)oxyethanesulfonic acid;(2-methylphenyl)-diphenylsulfanium?
The IUPAC name of 1,1-difluoro-2-(2-phenoxyacetyl)oxyethanesulfonic acid;(2-methylphenyl)-diphenylsulfanium (CID 87386428) is 1,1-difluoro-2-(2-phenoxyacetyl)oxyethanesulfonic acid;(2-methylphenyl)-diphenylsulfanium.
What is the SMILES notation for 1,1-difluoro-2-(2-phenoxyacetyl)oxyethanesulfonic acid;(2-methylphenyl)-diphenylsulfanium?
The canonical SMILES for 1,1-difluoro-2-(2-phenoxyacetyl)oxyethanesulfonic acid;(2-methylphenyl)-diphenylsulfanium is Cc1ccccc1[S+](c1ccccc1)c1ccccc1.O=C(COc1ccccc1)OCC(F)(F)S(=O)(=O)O.
What is the InChIKey of 1,1-difluoro-2-(2-phenoxyacetyl)oxyethanesulfonic acid;(2-methylphenyl)-diphenylsulfanium?
The InChIKey is KNCCFLULUBSBFC-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H17S.C10H10F2O6S/c1-16-10-8-9-15-19(16)20(17-11-4-2-5-12-17)18-13-6-3-7-14-18;11-10(12,19(14,15)16)7-18-9(13)6-17-8-4-2-1-3-5-8/h2-15H,1H3;1-5H,6-7H2,(H,14,15,16)/q+1;.
What are the key properties of 1,1-difluoro-2-(2-phenoxyacetyl)oxyethanesulfonic acid;(2-methylphenyl)-diphenylsulfanium?
1,1-difluoro-2-(2-phenoxyacetyl)oxyethanesulfonic acid;(2-methylphenyl)-diphenylsulfanium has a molecular weight of 573.66 g/mol, XLogP of 6.18, 9 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1-difluoro-2-(2-phenoxyacetyl)oxyethanesulfonic acid;(2-methylphenyl)-diphenylsulfanium is sourced from PubChem (CID 87386428), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).