C16H15ClF3N3O2S — CID 87386560
5-[[2-[(3S)-3-aminopiperidin-1-yl]-3-chloro-5-(trifluoromethyl)phenyl]methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 87386560) has the molecular formula C16H15ClF3N3O2S and a molecular weight of 405.83 g/mol. Its IUPAC name is 5-[[2-[(3S)-3-aminopiperidin-1-yl]-3-chloro-5-(trifluoromethyl)phenyl]methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | 5-[[2-[(3S)-3-aminopiperidin-1-yl]-3-chloro-5-(trifluoromethyl)phenyl]methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 87386560 |
| Molecular Formula | C16H15ClF3N3O2S |
| Molecular Weight | 405.83 g/mol |
| Exact Mass | 405.05 |
| IUPAC Name | 5-[[2-[(3S)-3-aminopiperidin-1-yl]-3-chloro-5-(trifluoromethyl)phenyl]methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | N[C@H]1CCCN(c2c(Cl)cc(C(F)(F)F)cc2C=C2SC(=O)NC2=O)C1 |
| InChI | InChI=1S/C16H15ClF3N3O2S/c17-11-6-9(16(18,19)20)4-8(5-12-14(24)22-15(25)26-12)13(11)23-3-1-2-10(21)7-23/h4-6,10H,1-3,7,21H2,(H,22,24,25)/t10-/m0/s1 |
| InChIKey | UXHVFDZYEHJJKH-JTQLQIEISA-N |
| XLogP | 3.61 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.83 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|