C36H28O8P2 — CID 87386590
[4-(4-hydroxy-2,3,5,6-tetraphenylphenyl)phenyl] phosphono hydrogen phosphate (PubChem CID 87386590) has the molecular formula C36H28O8P2 and a molecular weight of 650.56 g/mol. Its IUPAC name is [4-(4-hydroxy-2,3,5,6-tetraphenylphenyl)phenyl] phosphono hydrogen phosphate.
| Compound Name | [4-(4-hydroxy-2,3,5,6-tetraphenylphenyl)phenyl] phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 87386590 |
| Molecular Formula | C36H28O8P2 |
| Molecular Weight | 650.56 g/mol |
| Exact Mass | 650.13 |
| IUPAC Name | [4-(4-hydroxy-2,3,5,6-tetraphenylphenyl)phenyl] phosphono hydrogen phosphate |
| SMILES | O=P(O)(O)OP(=O)(O)Oc1ccc(-c2c(-c3ccccc3)c(-c3ccccc3)c(O)c(-c3ccccc3)c2-c2ccccc2)cc1 |
| InChI | InChI=1S/C36H28O8P2/c37-36-34(27-17-9-3-10-18-27)32(25-13-5-1-6-14-25)31(29-21-23-30(24-22-29)43-46(41,42)44-45(38,39)40)33(26-15-7-2-8-16-26)35(36)28-19-11-4-12-20-28/h1-24,37H,(H,41,42)(H2,38,39,40) |
| InChIKey | OLVMLSYRXLORLU-UHFFFAOYSA-N |
| XLogP | 9.32 |
| TPSA | 133.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.56 |
| LogP ≤ 5 | 9.32 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|