About benzhydrylsulfanylbenzene;1,1-difluoro-2-[2-(4-methoxyphenyl)acetyl]oxyethanesulfonic acid
benzhydrylsulfanylbenzene;1,1-difluoro-2-[2-(4-methoxyphenyl)acetyl]oxyethanesulfonic acid (PubChem CID 87386592) has the molecular formula C30H28F2O6S2
and a molecular weight of 586.68 g/mol. Its IUPAC name is benzhydrylsulfanylbenzene;1,1-difluoro-2-[2-(4-methoxyphenyl)acetyl]oxyethanesulfonic acid.
Molecular Properties
| Compound Name | benzhydrylsulfanylbenzene;1,1-difluoro-2-[2-(4-methoxyphenyl)acetyl]oxyethanesulfonic acid |
| PubChem CID | 87386592 |
| Molecular Formula | C30H28F2O6S2 |
| Molecular Weight | 586.68 g/mol |
| Exact Mass | 586.13 |
| IUPAC Name | benzhydrylsulfanylbenzene;1,1-difluoro-2-[2-(4-methoxyphenyl)acetyl]oxyethanesulfonic acid |
| SMILES | COc1ccc(CC(=O)OCC(F)(F)S(=O)(=O)O)cc1.c1ccc(SC(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C19H16S.C11H12F2O6S/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)20-18-14-8-3-9-15-18;1-18-9-4-2-8(3-5-9)6-10(14)19-7-11(12,13)20(15,16)17/h1-15,19H;2-5H,6-7H2,1H3,(H,15,16,17) |
| InChIKey | NKNOBIAVZCXISD-UHFFFAOYSA-N |
| XLogP | 6.83 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 586.68 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze benzhydrylsulfanylbenzene;1,1-difluoro-2-[2-(4-methoxyphenyl)acetyl]oxyethanesulfonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzhydrylsulfanylbenzene;1,1-difluoro-2-[2-(4-methoxyphenyl)acetyl]oxyethanesulfonic acid?
The IUPAC name of benzhydrylsulfanylbenzene;1,1-difluoro-2-[2-(4-methoxyphenyl)acetyl]oxyethanesulfonic acid (CID 87386592) is benzhydrylsulfanylbenzene;1,1-difluoro-2-[2-(4-methoxyphenyl)acetyl]oxyethanesulfonic acid.
What is the SMILES notation for benzhydrylsulfanylbenzene;1,1-difluoro-2-[2-(4-methoxyphenyl)acetyl]oxyethanesulfonic acid?
The canonical SMILES for benzhydrylsulfanylbenzene;1,1-difluoro-2-[2-(4-methoxyphenyl)acetyl]oxyethanesulfonic acid is COc1ccc(CC(=O)OCC(F)(F)S(=O)(=O)O)cc1.c1ccc(SC(c2ccccc2)c2ccccc2)cc1.
What is the InChIKey of benzhydrylsulfanylbenzene;1,1-difluoro-2-[2-(4-methoxyphenyl)acetyl]oxyethanesulfonic acid?
The InChIKey is NKNOBIAVZCXISD-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H16S.C11H12F2O6S/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)20-18-14-8-3-9-15-18;1-18-9-4-2-8(3-5-9)6-10(14)19-7-11(12,13)20(15,16)17/h1-15,19H;2-5H,6-7H2,1H3,(H,15,16,17).
What are the key properties of benzhydrylsulfanylbenzene;1,1-difluoro-2-[2-(4-methoxyphenyl)acetyl]oxyethanesulfonic acid?
benzhydrylsulfanylbenzene;1,1-difluoro-2-[2-(4-methoxyphenyl)acetyl]oxyethanesulfonic acid has a molecular weight of 586.68 g/mol, XLogP of 6.83, 10 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for benzhydrylsulfanylbenzene;1,1-difluoro-2-[2-(4-methoxyphenyl)acetyl]oxyethanesulfonic acid is sourced from PubChem (CID 87386592), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).