About 2-cyclopenta-2,4-dien-1-yl-7-methoxychromen-4-one;cyclopentane;iron
2-cyclopenta-2,4-dien-1-yl-7-methoxychromen-4-one;cyclopentane;iron (PubChem CID 87386627) has the molecular formula C20H16FeO3-6
and a molecular weight of 360.19 g/mol. Its IUPAC name is 2-cyclopenta-2,4-dien-1-yl-7-methoxychromen-4-one;cyclopentane;iron.
Molecular Properties
| Compound Name | 2-cyclopenta-2,4-dien-1-yl-7-methoxychromen-4-one;cyclopentane;iron |
| PubChem CID | 87386627 |
| Molecular Formula | C20H16FeO3-6 |
| Molecular Weight | 360.19 g/mol |
| Exact Mass | 360.05 |
| IUPAC Name | 2-cyclopenta-2,4-dien-1-yl-7-methoxychromen-4-one;cyclopentane;iron |
| SMILES | COc1ccc2c(=O)cc(-[c-]3cccc3)oc2c1.[Fe].[cH-]1[cH-][cH-][cH-][cH-]1 |
| InChI | InChI=1S/C15H11O3.C5H5.Fe/c1-17-11-6-7-12-13(16)9-14(18-15(12)8-11)10-4-2-3-5-10;1-2-4-5-3-1;/h2-9H,1H3;1-5H;/q-1;-5; |
| InChIKey | IGYNLVZVCALKKF-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 39.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 360.19 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 2-cyclopenta-2,4-dien-1-yl-7-methoxychromen-4-one;cyclopentane;iron with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyclopenta-2,4-dien-1-yl-7-methoxychromen-4-one;cyclopentane;iron?
The IUPAC name of 2-cyclopenta-2,4-dien-1-yl-7-methoxychromen-4-one;cyclopentane;iron (CID 87386627) is 2-cyclopenta-2,4-dien-1-yl-7-methoxychromen-4-one;cyclopentane;iron.
What is the SMILES notation for 2-cyclopenta-2,4-dien-1-yl-7-methoxychromen-4-one;cyclopentane;iron?
The canonical SMILES for 2-cyclopenta-2,4-dien-1-yl-7-methoxychromen-4-one;cyclopentane;iron is COc1ccc2c(=O)cc(-[c-]3cccc3)oc2c1.[Fe].[cH-]1[cH-][cH-][cH-][cH-]1.
What is the InChIKey of 2-cyclopenta-2,4-dien-1-yl-7-methoxychromen-4-one;cyclopentane;iron?
The InChIKey is IGYNLVZVCALKKF-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H11O3.C5H5.Fe/c1-17-11-6-7-12-13(16)9-14(18-15(12)8-11)10-4-2-3-5-10;1-2-4-5-3-1;/h2-9H,1H3;1-5H;/q-1;-5;.
What are the key properties of 2-cyclopenta-2,4-dien-1-yl-7-methoxychromen-4-one;cyclopentane;iron?
2-cyclopenta-2,4-dien-1-yl-7-methoxychromen-4-one;cyclopentane;iron has a molecular weight of 360.19 g/mol, XLogP of 4.59, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyclopenta-2,4-dien-1-yl-7-methoxychromen-4-one;cyclopentane;iron is sourced from PubChem (CID 87386627), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).