C12H17ClN2O3 — CID 87386659
4-carbamoyl-3-(ethylamino)-2,5-dimethylbenzoic acid;hydrochloride (PubChem CID 87386659) has the molecular formula C12H17ClN2O3 and a molecular weight of 272.73 g/mol. Its IUPAC name is 4-carbamoyl-3-(ethylamino)-2,5-dimethylbenzoic acid;hydrochloride.
| Compound Name | 4-carbamoyl-3-(ethylamino)-2,5-dimethylbenzoic acid;hydrochloride |
|---|---|
| PubChem CID | 87386659 |
| Molecular Formula | C12H17ClN2O3 |
| Molecular Weight | 272.73 g/mol |
| Exact Mass | 272.09 |
| IUPAC Name | 4-carbamoyl-3-(ethylamino)-2,5-dimethylbenzoic acid;hydrochloride |
| SMILES | CCNc1c(C)c(C(=O)O)cc(C)c1C(N)=O.Cl |
| InChI | InChI=1S/C12H16N2O3.ClH/c1-4-14-10-7(3)8(12(16)17)5-6(2)9(10)11(13)15;/h5,14H,4H2,1-3H3,(H2,13,15)(H,16,17);1H |
| InChIKey | USFLCLMIAKPKHF-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.73 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |