C81H102O — CID 87386886
1-[3,5-bis[3,5-bis(3,5-ditert-butylphenyl)-2-ethenylphenyl]phenyl]prop-2-en-1-ol (PubChem CID 87386886) has the molecular formula C81H102O and a molecular weight of 1091.71 g/mol. Its IUPAC name is 1-[3,5-bis[3,5-bis(3,5-ditert-butylphenyl)-2-ethenylphenyl]phenyl]prop-2-en-1-ol.
| Compound Name | 1-[3,5-bis[3,5-bis(3,5-ditert-butylphenyl)-2-ethenylphenyl]phenyl]prop-2-en-1-ol |
|---|---|
| PubChem CID | 87386886 |
| Molecular Formula | C81H102O |
| Molecular Weight | 1091.71 g/mol |
| Exact Mass | 1090.79 |
| IUPAC Name | 1-[3,5-bis[3,5-bis(3,5-ditert-butylphenyl)-2-ethenylphenyl]phenyl]prop-2-en-1-ol |
| SMILES | C=Cc1c(-c2cc(-c3cc(-c4cc(C(C)(C)C)cc(C(C)(C)C)c4)cc(-c4cc(C(C)(C)C)cc(C(C)(C)C)c4)c3C=C)cc(C(O)C=C)c2)cc(-c2cc(C(C)(C)C)cc(C(C)(C)C)c2)cc1-c1cc(C(C)(C)C)cc(C(C)(C)C)c1 |
| InChI | InChI=1S/C81H102O/c1-28-67-69(42-52(50-34-59(74(4,5)6)46-60(35-50)75(7,8)9)44-71(67)56-38-63(78(16,17)18)48-64(39-56)79(19,20)21)54-31-55(33-58(32-54)73(82)30-3)70-43-53(51-36-61(76(10,11)12)47-62(37-51)77(13,14)15)45-72(68(70)29-2)57-40-65(80(22,23)24)49-66(41-57)81(25,26)27/h28-49,73,82H,1-3H2,4-27H3 |
| InChIKey | XGRCFSPZDHXBAT-UHFFFAOYSA-N |
| XLogP | 23.57 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 82 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1091.71 |
| LogP ≤ 5 | 23.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|