About 2-N,2-N-dimethylprop-1-ene-1,1,2-triamine
2-N,2-N-dimethylprop-1-ene-1,1,2-triamine (PubChem CID 87387205) has the molecular formula C5H13N3
and a molecular weight of 115.18 g/mol. Its IUPAC name is 2-N,2-N-dimethylprop-1-ene-1,1,2-triamine.
Molecular Properties
| Compound Name | 2-N,2-N-dimethylprop-1-ene-1,1,2-triamine |
| PubChem CID | 87387205 |
| Molecular Formula | C5H13N3 |
| Molecular Weight | 115.18 g/mol |
| Exact Mass | 115.11 |
| IUPAC Name | 2-N,2-N-dimethylprop-1-ene-1,1,2-triamine |
| SMILES | CC(=C(N)N)N(C)C |
| InChI | InChI=1S/C5H13N3/c1-4(5(6)7)8(2)3/h6-7H2,1-3H3 |
| InChIKey | PJSUMAQFDYZJCN-UHFFFAOYSA-N |
| XLogP | -0.35 |
| TPSA | 55.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 115.18 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-N,2-N-dimethylprop-1-ene-1,1,2-triamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-N,2-N-dimethylprop-1-ene-1,1,2-triamine?
The IUPAC name of 2-N,2-N-dimethylprop-1-ene-1,1,2-triamine (CID 87387205) is 2-N,2-N-dimethylprop-1-ene-1,1,2-triamine.
What is the SMILES notation for 2-N,2-N-dimethylprop-1-ene-1,1,2-triamine?
The canonical SMILES for 2-N,2-N-dimethylprop-1-ene-1,1,2-triamine is CC(=C(N)N)N(C)C.
What is the InChIKey of 2-N,2-N-dimethylprop-1-ene-1,1,2-triamine?
The InChIKey is PJSUMAQFDYZJCN-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H13N3/c1-4(5(6)7)8(2)3/h6-7H2,1-3H3.
What are the key properties of 2-N,2-N-dimethylprop-1-ene-1,1,2-triamine?
2-N,2-N-dimethylprop-1-ene-1,1,2-triamine has a molecular weight of 115.18 g/mol, XLogP of -0.35, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-N,2-N-dimethylprop-1-ene-1,1,2-triamine is sourced from PubChem (CID 87387205), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).