C17H20N2O3S — CID 8738726
[(2R)-1-(tert-butylamino)-1-oxopropan-2-yl] (E)-3-(1,3-benzothiazol-2-yl)prop-2-enoate (PubChem CID 8738726) has the molecular formula C17H20N2O3S and a molecular weight of 332.43 g/mol. Its IUPAC name is [(2R)-1-(tert-butylamino)-1-oxopropan-2-yl] (E)-3-(1,3-benzothiazol-2-yl)prop-2-enoate.
| Compound Name | [(2R)-1-(tert-butylamino)-1-oxopropan-2-yl] (E)-3-(1,3-benzothiazol-2-yl)prop-2-enoate |
|---|---|
| PubChem CID | 8738726 |
| Molecular Formula | C17H20N2O3S |
| Molecular Weight | 332.43 g/mol |
| Exact Mass | 332.12 |
| IUPAC Name | [(2R)-1-(tert-butylamino)-1-oxopropan-2-yl] (E)-3-(1,3-benzothiazol-2-yl)prop-2-enoate |
| SMILES | C[C@@H](OC(=O)/C=C/c1nc2ccccc2s1)C(=O)NC(C)(C)C |
| InChI | InChI=1S/C17H20N2O3S/c1-11(16(21)19-17(2,3)4)22-15(20)10-9-14-18-12-7-5-6-8-13(12)23-14/h5-11H,1-4H3,(H,19,21)/b10-9+/t11-/m1/s1 |
| InChIKey | RKRXBVTWHFDHEK-PBQZMEPESA-N |
| XLogP | 3.16 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.43 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|