C32H46N4O6 — CID 87387345
[(3S)-3-benzyl-2-[[(2S)-1-(carboxyamino)-1-oxopropan-2-yl]amino]-11-(1-oxopropan-2-ylamino)-1-phenylundecan-2-yl]carbamic acid (PubChem CID 87387345) has the molecular formula C32H46N4O6 and a molecular weight of 582.74 g/mol. Its IUPAC name is [(3S)-3-benzyl-2-[[(2S)-1-(carboxyamino)-1-oxopropan-2-yl]amino]-11-(1-oxopropan-2-ylamino)-1-phenylundecan-2-yl]carbamic acid.
| Compound Name | [(3S)-3-benzyl-2-[[(2S)-1-(carboxyamino)-1-oxopropan-2-yl]amino]-11-(1-oxopropan-2-ylamino)-1-phenylundecan-2-yl]carbamic acid |
|---|---|
| PubChem CID | 87387345 |
| Molecular Formula | C32H46N4O6 |
| Molecular Weight | 582.74 g/mol |
| Exact Mass | 582.34 |
| IUPAC Name | [(3S)-3-benzyl-2-[[(2S)-1-(carboxyamino)-1-oxopropan-2-yl]amino]-11-(1-oxopropan-2-ylamino)-1-phenylundecan-2-yl]carbamic acid |
| SMILES | CC(C=O)NCCCCCCCC[C@@H](Cc1ccccc1)C(Cc1ccccc1)(NC(=O)O)N[C@@H](C)C(=O)NC(=O)O |
| InChI | InChI=1S/C32H46N4O6/c1-24(23-37)33-20-14-6-4-3-5-13-19-28(21-26-15-9-7-10-16-26)32(36-31(41)42,22-27-17-11-8-12-18-27)35-25(2)29(38)34-30(39)40/h7-12,15-18,23-25,28,33,35-36H,3-6,13-14,19-22H2,1-2H3,(H,34,38)(H,39,40)(H,41,42)/t24?,25-,28-,32?/m0/s1 |
| InChIKey | XLQZXUHBDONFSL-BMAFGOHASA-N |
| XLogP | 4.73 |
| TPSA | 156.86 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.74 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|