About N-(2-amino-1,3-thiazol-4-yl)-N-methylmethanesulfonamide
N-(2-amino-1,3-thiazol-4-yl)-N-methylmethanesulfonamide (PubChem CID 87387410) has the molecular formula C5H9N3O2S2
and a molecular weight of 207.28 g/mol. Its IUPAC name is N-(2-amino-1,3-thiazol-4-yl)-N-methylmethanesulfonamide.
Molecular Properties
| Compound Name | N-(2-amino-1,3-thiazol-4-yl)-N-methylmethanesulfonamide |
| PubChem CID | 87387410 |
| Molecular Formula | C5H9N3O2S2 |
| Molecular Weight | 207.28 g/mol |
| Exact Mass | 207.01 |
| IUPAC Name | N-(2-amino-1,3-thiazol-4-yl)-N-methylmethanesulfonamide |
| SMILES | CN(c1csc(N)n1)S(C)(=O)=O |
| InChI | InChI=1S/C5H9N3O2S2/c1-8(12(2,9)10)4-3-11-5(6)7-4/h3H,1-2H3,(H2,6,7) |
| InChIKey | ZIPVAXCEHATKHE-UHFFFAOYSA-N |
| XLogP | 0.12 |
| TPSA | 76.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.28 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-(2-amino-1,3-thiazol-4-yl)-N-methylmethanesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-amino-1,3-thiazol-4-yl)-N-methylmethanesulfonamide?
The IUPAC name of N-(2-amino-1,3-thiazol-4-yl)-N-methylmethanesulfonamide (CID 87387410) is N-(2-amino-1,3-thiazol-4-yl)-N-methylmethanesulfonamide.
What is the SMILES notation for N-(2-amino-1,3-thiazol-4-yl)-N-methylmethanesulfonamide?
The canonical SMILES for N-(2-amino-1,3-thiazol-4-yl)-N-methylmethanesulfonamide is CN(c1csc(N)n1)S(C)(=O)=O.
What is the InChIKey of N-(2-amino-1,3-thiazol-4-yl)-N-methylmethanesulfonamide?
The InChIKey is ZIPVAXCEHATKHE-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H9N3O2S2/c1-8(12(2,9)10)4-3-11-5(6)7-4/h3H,1-2H3,(H2,6,7).
What are the key properties of N-(2-amino-1,3-thiazol-4-yl)-N-methylmethanesulfonamide?
N-(2-amino-1,3-thiazol-4-yl)-N-methylmethanesulfonamide has a molecular weight of 207.28 g/mol, XLogP of 0.12, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-amino-1,3-thiazol-4-yl)-N-methylmethanesulfonamide is sourced from PubChem (CID 87387410), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).