C14H15Cl2F3N2O5 — CID 87387442
(4Z)-4-(2-aminoethoxyimino)-4-(3,4-dichlorophenyl)butanoic acid;2,2,2-trifluoroacetic acid (PubChem CID 87387442) has the molecular formula C14H15Cl2F3N2O5 and a molecular weight of 419.18 g/mol. Its IUPAC name is (4Z)-4-(2-aminoethoxyimino)-4-(3,4-dichlorophenyl)butanoic acid;2,2,2-trifluoroacetic acid.
| Compound Name | (4Z)-4-(2-aminoethoxyimino)-4-(3,4-dichlorophenyl)butanoic acid;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 87387442 |
| Molecular Formula | C14H15Cl2F3N2O5 |
| Molecular Weight | 419.18 g/mol |
| Exact Mass | 418.03 |
| IUPAC Name | (4Z)-4-(2-aminoethoxyimino)-4-(3,4-dichlorophenyl)butanoic acid;2,2,2-trifluoroacetic acid |
| SMILES | NCCO/N=C(/CCC(=O)O)c1ccc(Cl)c(Cl)c1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C12H14Cl2N2O3.C2HF3O2/c13-9-2-1-8(7-10(9)14)11(3-4-12(17)18)16-19-6-5-15;3-2(4,5)1(6)7/h1-2,7H,3-6,15H2,(H,17,18);(H,6,7)/b16-11-; |
| InChIKey | KQUAUCLYMJUBMV-MWVRIADDSA-N |
| XLogP | 3.17 |
| TPSA | 122.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.18 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|